dangerous-subs-eco-labels
dangerous-subs-eco-labels
Ecolabels - Restrictions for Hazardous Substances/Mixtures
This list contains a non-exhaustive inventory of substances based on the list of hazardous substances with harmonised classification and labelling (i.e. Table 3 of Annex VI to the CLP Regulation), and the Candidate List of substances of very high concern (SVHCs). Pursuant to Article 6(6) of the EU Ecolabel Regulation, the ecolabel must not be awarded to goods containing substances or mixtures classified according to the CLP as toxic; hazardous to the environment; and carcinogenic, mutagenic, or toxic for reproduction (CMRs). Nor are products allowed the ecolabel award when they contain SVHCs (per Article 57 of REACH). While the CLP's harmonised list contains many such substances, other ones not listed in Table 3 may also meet the criteria specified for classification under the CLP.
arsenic compounds, with the exception of those specified elsewhere in this Annex
ecnumber: - casnumber: -| Table 3 of Annex VI to CLP |
yes
|
Help
Group members
substance-members-text
Results list is empty
| Name | EC / List no. | CAS no. | Association |
|---|---|---|---|
| Arsenic acid (H3AsO4), copper(2+) salt (2:3) | - | - | diss.rml.association.type.EXPERT |
| Difetarsone disodium | 208-209-0 | 515-76-4 | diss.rml.association.type.EXPERT |
| 4-[(2-arsonophenyl)azo]-3-hydroxynaphthalene-2,7-disulphonic acid | 205-058-2 | 132-33-2 | diss.rml.association.type.EXPERT |
| Iron arsenate | 233-274-7 | 10102-49-5 | diss.rml.association.type.EXPERT_ECHA |
| Allylarsonic acid | 209-678-4 | 590-34-1 | diss.rml.association.type.EXPERT |
| [4-[(4,6-diamino-1,3,5-triazin-2-yl)amino]phenyl]arsonic acid | 227-365-0 | 5806-89-3 | diss.rml.association.type.EXPERT |
| Strontium arsenide (SrAs3) | - | 61462-16-6 | diss.rml.association.type.EXPERT |
| Bis(pentane-2,4-dionato-O,O')boron(1+) hexafluoroarsenate(1-) | 272-591-5 | 68892-01-3 | diss.rml.association.type.EXPERT_ECHA |
| [No public or meaningful name is available] | - | 16973-45-8 | diss.rml.association.type.EXPERT |
| Tritylium hexafluoroarsenate | 207-111-5 | 437-15-0 | diss.rml.association.type.EXPERT_ECHA |
| Bis[(2-diphenylarsinoethyl)phenyl]phosphine | 245-756-4 | 23582-05-0 | diss.rml.association.type.EXPERT |
| Antimony arsenate | 249-347-1 | 28980-47-4 | diss.rml.association.type.EXPERT_ECHA |
| Arsenic acid, calcium salt (1:2) | - | 13464-39-6 | diss.rml.association.type.EXPERT |
| Yttrium arsenide | 235-507-8 | 12255-48-0 | diss.rml.association.type.EXPERT_ECHA |
| Sodium p-[[4-[3-(2-arsono-4-nitrophenyl)triazen-1-yl]phenyl]azo]benzenesulphonate | 217-197-6 | 1772-02-7 | diss.rml.association.type.EXPERT |
| Tristrontium diarsenate | 236-684-4 | 13464-68-1 | diss.rml.association.type.EXPERT_ECHA |
| (diphenylarsino)dimethylgallium | 302-587-1 | 94113-53-8 | diss.rml.association.type.EXPERT |
| Platinum arsenide (PtAs2) | - | 12044-52-9 | diss.rml.association.type.EXPERT |
| Arsenic tetrachloride fluoride | - | 87198-15-0 | diss.rml.association.type.EXPERT |
| Potassium dihydrogenarsenate | 232-065-8 | 7784-41-0 | diss.rml.association.type.EXPERT_ECHA |
| (2-Chloroethenyl)arsonous dichloride | - | 541-25-3 | diss.rml.association.type.EXPERT |
| Tetraphenylarsonium chloride | 208-070-6 | 507-28-8 | diss.rml.association.type.EXPERT |
| Arsenic acid (H3AsO4), monopotassium salt, 1/5hydrate | - | 164170-84-7 | diss.rml.association.type.EXPERT |
| Diphenylarsinecarbonitrile | 245-716-6 | 23525-22-6 | diss.rml.association.type.EXPERT |
| Boron arsenate | - | 13510-31-1 | diss.rml.association.type.EXPERT |
| Benzenesulfonic acid, 4-arsenoso-, sodium salt | - | 71130-50-2 | diss.rml.association.type.EXPERT |
| Arsenic acid (H3AsO4), lead(2+) salt (2:3), tetrahydrate | - | 120119-64-4 | diss.rml.association.type.EXPERT |
| Arsine, tris(2-chloroethenyl)- | - | 40334-70-1 | diss.rml.association.type.EXPERT |
| Methylarsonic acid | 204-705-6 | 124-58-3 | diss.rml.association.type.EXPERT |
| Tribarium diarsenate | 236-762-8 | 13477-04-8 | diss.rml.association.type.EXPERT_ECHA |
| Sodium cacodylate trihydrate | 682-793-9 | 6131-99-3 | diss.rml.association.type.EXPERT_ECHA |
| Arsenic acid (H3AsO4), copper(2+) salt (4:1) | - | 102525-64-4 | diss.rml.association.type.EXPERT |
| Calcium arsenate (CaHAsO4) (6CI,7CI) | 672-782-7 | 15195-00-3 | diss.rml.association.type.EXPERT |
| Sodium arsenate dibasic heptahydrate | 677-900-0 | 10048-95-0 | diss.rml.association.type.EXPERT_ECHA |
| Tri-p-tolylarsine | 220-776-6 | 2896-10-8 | diss.rml.association.type.EXPERT |
| Diammonium hydrogenarsenate | 232-067-9 | 7784-44-3 | diss.rml.association.type.EXPERT_ECHA |
| Manganese hydrogenarsenate | 232-063-7 | 7784-38-5 | diss.rml.association.type.EXPERT_ECHA |
| Sodium hydrogen 4-aminophenylarsonate | 204-869-9 | 127-85-5 | diss.rml.association.type.EXPERT |
| Strychnine dimethylarsinate | 233-973-7 | 10476-87-6 | diss.rml.association.type.EXPERT |
| Tetramethyldiarsine | 207-440-4 | 471-35-2 | diss.rml.association.type.EXPERT |
| Arsenic acid (H3AsO4), monosodium salt | - | 10103-60-3 | diss.rml.association.type.EXPERT |
| 4-chlorophenylarsonic acid | 226-622-4 | 5440-04-0 | diss.rml.association.type.EXPERT |
| Methyldiphenylarsine | 213-414-3 | 945-48-2 | diss.rml.association.type.EXPERT |
| Acetarsol--diethylamine (1:1) | 208-597-1 | 534-33-8 | diss.rml.association.type.EXPERT |
| Trilithium arsenate | 236-773-8 | 13478-14-3 | diss.rml.association.type.EXPERT_ECHA |
| ARSENIC ACID (H3ASO4), HEMIHYDRATE | - | 7774-41-6 | diss.rml.association.type.EXPERT |
| Diarsenic tritelluride | 234-955-1 | 12044-54-1 | diss.rml.association.type.EXPERT_ECHA |
| Disodium 3-[[2-[(dihydroxyarsino)oxy]phenyl]azo]-4,5-dihydroxynaphthalene-2,7-disulphonate | 282-454-1 | 84215-48-5 | diss.rml.association.type.EXPERT |
| Arsenic tetrasulfide | - | 56729-51-2 | diss.rml.association.type.EXPERT |
| Diphenoxarsin-10-yl oxide | 200-377-3 | 58-36-6 | diss.rml.association.type.EXPERT |
| o-phenylenebis(dimethylarsine) | 236-227-9 | 13246-32-7 | diss.rml.association.type.EXPERT |
| Cobalt arsenide (CoAs3) | - | 12256-04-1 | diss.rml.association.type.EXPERT |
| Ammonium magnesium arsenate | - | 14644-70-3 | diss.rml.association.type.EXPERT |
| Europium arsenide | 251-206-4 | 32775-46-5 | diss.rml.association.type.EXPERT_ECHA |
| Arsenic sulfide | 235-720-6 | 12612-21-4 | diss.rml.association.type.EXPERT_ECHA |
| arsenic acid (H3AsO4), calcium salt(2:3), dihydrate | - | 30621-31-9 | diss.rml.association.type.EXPERT |
| Sodium hydrogen allylarsonate | 304-710-4 | 94278-22-5 | diss.rml.association.type.EXPERT |
| Disodium p-tolylarsonate | 304-956-2 | 94313-58-3 | diss.rml.association.type.EXPERT |
| Cobalt arsenide (CoAs2) | - | 12044-42-7 | diss.rml.association.type.EXPERT |
| Nickel arsenide | 248-169-1 | 27016-75-7 | diss.rml.association.type.EXPERT_ECHA |
| Arsenic acid, sodium salt | 231-547-5 | 7631-89-2 | diss.rml.association.type.EXPERT_ECHA |
| Diphenylarsine | 212-589-3 | 829-83-4 | diss.rml.association.type.EXPERT |
| Trinickel bis(arsenate) | 236-771-7 | 13477-70-8 | diss.rml.association.type.EXPERT_ECHA |
| Leucomycin V, 9-O-[5-(dimethylamino)tetrahydro-6-methyl-2H-pyran-2-yl]-, [9(5S,6R)]-, [1,2-ethanediylbis(imino-4,1-phenylene)]bis[arsonate] (1:1) (salt) | 299-051-1 | 93841-79-3 | diss.rml.association.type.EXPERT |
| Dichromium arsenide | 235-499-6 | 12254-85-2 | diss.rml.association.type.EXPERT_ECHA |
| Methyltriphenylarsonium iodide | 216-108-8 | 1499-33-8 | diss.rml.association.type.EXPERT |
| Vanadium(4+) diarsenate (1:1) | 308-917-0 | 99035-51-5 | diss.rml.association.type.EXPERT_ECHA |
| Acetarsol | 202-582-3 | 97-44-9 | diss.rml.association.type.EXPERT |
| 4-cyclohexyl-2,6-dimethylpyrylium hexafluoroarsenate | 282-701-3 | 84304-16-5 | diss.rml.association.type.EXPERT_ECHA |
| Lead hydrogen arsenate | 232-064-2 | 7784-40-9 | diss.rml.association.type.EXPERT_ECHA |
| Tripotassium arsenide | 234-949-9 | 12044-21-2 | diss.rml.association.type.EXPERT_ECHA |
| Methyl 17α-hydroxyyohimban-16α-carboxylate, methylarsonate (1:1) | 279-628-4 | 80925-03-7 | diss.rml.association.type.EXPERT |
| Arsenic acid (H3AsO4), lead(4+) salt (2:1), monohydrate | - | 33940-95-3 | diss.rml.association.type.EXPERT |
| Arsonic acid, methyl-, calcium salt (1:1) | - | 6423-72-9 | diss.rml.association.type.EXPERT |
| Ammonium copper arsenate | 251-151-6 | 32680-29-8 | diss.rml.association.type.EXPERT_ECHA |
| Disodium 3,6-bis[[2-[(dihydroxyarsino)oxy]phenyl]azo]-4,5-dihydroxynaphthalene-2,7-disulphonate | 282-453-6 | 84215-47-4 | diss.rml.association.type.EXPERT |
| Arsenic acid (H3AsO4), copper(2+) salt (1:1) | - | 13464-31-8 | diss.rml.association.type.EXPERT |
| Erbium arsenide | 235-501-5 | 12254-88-5 | diss.rml.association.type.EXPERT_ECHA |
| Arsonic acid, [4-[[4-(dimethylamino)phenyl]azo]phenyl]-, monohydrochloride | 620-678-7 | 73688-85-4 | diss.rml.association.type.EXPERT |
| Arsenic disulfide | 627-949-9 | 1303-32-8 | diss.rml.association.type.EXPERT |
| 4-(2-chloroacetamido)phenylarsonic acid | 226-569-7 | 5425-62-7 | diss.rml.association.type.EXPERT |
| Arsenic acid, tripotassium salt | - | 13464-36-3 | diss.rml.association.type.EXPERT |
| Tetraphenylarsonium chloride, compound with hydrochloric acid (1:1) | 277-208-5 | 73003-83-5 | diss.rml.association.type.EXPERT |
| 10-[(dimethylthiocarbamoyl)thio]-5,10-dihydrophenarsazine | 225-368-1 | 4808-24-6 | diss.rml.association.type.EXPERT |
| Propylarsonic acid | 203-482-2 | 107-34-6 | diss.rml.association.type.EXPERT |
| Diiron arsenide | 234-474-7 | 12005-88-8 | diss.rml.association.type.EXPERT_ECHA |
| Thulium arsenide | 234-482-0 | 12006-10-9 | diss.rml.association.type.EXPERT_ECHA |
| Triantimony arsenide | 235-505-7 | 12255-36-6 | diss.rml.association.type.EXPERT_ECHA |
| Arsenenous acid, praseodymium(3+) salt | - | 86859-92-9 | diss.rml.association.type.EXPERT |
| Arsenous acid, tripotassium salt | - | 36267-15-9 | diss.rml.association.type.EXPERT |
| Calcium bis(dimethylarsinate) | 227-311-6 | 5785-43-3 | diss.rml.association.type.EXPERT |
| Sodium hydrogen [4-[(hydroxyacetyl)amino]phenyl]arsonate | 205-415-2 | 140-45-4 | diss.rml.association.type.EXPERT |
| Arsenous acid, copper(2+) salt, hydrate, (2:3:3) | - | 73156-86-2 | diss.rml.association.type.EXPERT |
| [No public or meaningful name is available] | - | 37337-11-4 | diss.rml.association.type.EXPERT |
| Arsenopyrite, cobaltoan | - | 12414-94-7 | diss.rml.association.type.EXPERT |
| Arsenous acid, iron(3+) salt (1:1) | - | 60168-33-4 | diss.rml.association.type.EXPERT |
| Arsenenous acid, mercury(2+) salt | - | 82980-40-3 | diss.rml.association.type.EXPERT |
| 4-(4-aminophenylazo)phenylarsonic acid | 230-176-6 | 6966-64-9 | diss.rml.association.type.EXPERT |
| Arsenic acid, copper(2+) salt | 249-916-4 | 29871-13-4 | diss.rml.association.type.EXPERT_ECHA |
| Arsenenous acid, cerium(3+) salt | - | 86859-93-0 | diss.rml.association.type.EXPERT |
| Potassium hexafluoroarsenate | 241-102-7 | 17029-22-0 | diss.rml.association.type.EXPERT_ECHA |
| Arsenic acid, (H3-As-O4), lead(4+) salt (4:3) | - | 53404-12-9 | diss.rml.association.type.EXPERT |
| Arsenenous acid, zinc salt | - | 10326-24-6 | diss.rml.association.type.EXPERT |
| Dichloro(ethyl)arsine | 209-919-3 | 598-14-1 | diss.rml.association.type.EXPERT |
| Tris[(8α,9R)-6'-methoxycinchonan-9-ol] bis(arsenate) | 208-971-4 | 549-59-7 | diss.rml.association.type.EXPERT_ECHA |
| Acetarsol sodium | 259-714-8 | 55588-51-7 | diss.rml.association.type.EXPERT |
| Thiobis[methylarsine], anhydrosulphide | 236-436-5 | 13367-92-5 | diss.rml.association.type.EXPERT |
| Iron arsenide | 234-947-8 | 12044-16-5 | diss.rml.association.type.EXPERT_ECHA |
| Silicic acid (H4SiO4), zinc salt (1:2), arsenic and manganese-doped | 271-895-5 | 68611-46-1 | diss.rml.association.type.EXPERT_ECHA |
| Arsenenous acid | - | 13768-07-5 | diss.rml.association.type.EXPERT |
| Calcium arsenate fluoride | - | 17068-86-9 | diss.rml.association.type.EXPERT |
| Triethyl arsenite | 221-543-1 | 3141-12-6 | diss.rml.association.type.EXPERT_ECHA |
| Proustite (Ag3(AsS3)) | 239-179-7 | 15122-58-4 | diss.rml.association.type.EXPERT |
| Roxarsone | 204-453-7 | 121-19-7 | diss.rml.association.type.EXPERT_ECHA |
| Sodium dimethylarsinate | 204-708-2 | 124-65-2 | diss.rml.association.type.EXPERT_ECHA |
| Diiodo(phenyl)arsine | 228-965-5 | 6380-34-3 | diss.rml.association.type.EXPERT |
| 2,6-dimethyl-4-(1-naphthyl)pyrylium hexafluoroarsenate | 282-682-1 | 84282-36-0 | diss.rml.association.type.EXPERT_ECHA |
| Zinc diarsenide | 234-956-7 | 12044-55-2 | diss.rml.association.type.EXPERT_ECHA |
| 4-(4-dimethylaminophenylazo)phenylarsonic acid | 210-750-2 | 622-68-4 | diss.rml.association.type.EXPERT |
| Triphenylsulphonium hexafluoroarsenate(1-) | 261-009-5 | 57900-42-2 | diss.rml.association.type.EXPERT_ECHA |
| Potassium arsonate | 233-337-9 | 10124-50-2 | diss.rml.association.type.EXPERT |
| Arsenenous acid, manganese(2+) salt | - | 85561-29-1 | diss.rml.association.type.EXPERT |
| Disodium hydrogenarsenate | 231-902-4 | 7778-43-0 | diss.rml.association.type.EXPERT_ECHA |
| Diarsenic acid | - | 13453-15-1 | diss.rml.association.type.EXPERT |
| Arsenic acid | 231-901-9 | 7778-39-4 | diss.rml.association.type.EXPERT_ECHA |
| Chlorodiphenylarsine | 211-921-4 | 712-48-1 | diss.rml.association.type.EXPERT |
| Arsenic chloride (AsCl) | - | 17522-78-0 | diss.rml.association.type.EXPERT |
| Tris(pentane-2,4-dionato-O,O')silicon hexafluoroarsenate | 266-621-6 | 67251-38-1 | diss.rml.association.type.EXPERT_ECHA |
| 10-chloro-5,10-dihydrophenarsazine | 209-433-1 | 578-94-9 | diss.rml.association.type.EXPERT |
| Antimony oxide (Sb2O3), mixed with arsenic oxide (As2O3) | 273-156-2 | 68951-38-2 | diss.rml.association.type.EXPERT_ECHA |
| Arsenic acid (H3AsO4), copper(2+) salt (1:1), sesquihydrate | - | 88442-64-2 | diss.rml.association.type.EXPERT |
| Thallium triarsenide | 281-902-3 | 84057-85-2 | diss.rml.association.type.EXPERT_ECHA |
| Triethylarsine | 210-526-4 | 617-75-4 | diss.rml.association.type.EXPERT |
| Arsenenous acid, cesium salt | - | 82005-78-5 | diss.rml.association.type.EXPERT |
| Arsonate | - | 36465-76-6 | diss.rml.association.type.EXPERT |
| Sodium dioxoarsenate | 232-070-5 | 7784-46-5 | diss.rml.association.type.EXPERT_ECHA |
| Nickel arsenide | - | 12795-30-1 | diss.rml.association.type.EXPERT |
| Tetraarsenic tetrasulfide | - | 12279-90-2 | diss.rml.association.type.EXPERT |
| Ethylenebis(diphenylarsine) | 224-629-7 | 4431-24-7 | diss.rml.association.type.EXPERT |
| Arsenic acid (H3AsO4), dipotassium salt | - | 21093-83-4 | diss.rml.association.type.EXPERT |
| Arsenious acid (HAsO2), strontium salt | - | 15195-06-9 | diss.rml.association.type.EXPERT |
| Arsenic acid (H3AsO4), magnesium salt, manganese-doped | 310-019-9 | 102110-21-4 | diss.rml.association.type.EXPERT_ECHA |
| ARSENIC(V) OXIDE HYDRATE | 629-626-8 | 12044-50-7 | diss.rml.association.type.EXPERT |
| 6,6'-dihydroxy-3,3'-diarsene-1,2-diyldianilinium dichloride | 205-386-6 | 139-93-5 | diss.rml.association.type.EXPERT_ECHA |
| Tris[(8α)-6'-methoxycinchonan-9(R)-ol] arsenite | 303-002-2 | 94138-87-1 | diss.rml.association.type.EXPERT_ECHA |
| 4-(diethylamino)-2-ethoxybenzenediazonium hexafluoroarsenate | 264-027-1 | 63217-33-4 | diss.rml.association.type.EXPERT_ECHA |
| Arsonic acid, monoammonium salt | - | 54058-01-4 | diss.rml.association.type.EXPERT |
| Tricadmium diarsenide | 234-484-1 | 12006-15-4 | diss.rml.association.type.EXPERT |
| Arsenenous acid, rubidium salt | - | 85906-44-1 | diss.rml.association.type.EXPERT |
| Disodium hydrogen 2-[[7-[(2-arsonophenyl)azo]-1,8-dihydroxy-3,6-disulphonato-2-naphthyl]azo]benzoate | 238-715-7 | 14674-83-0 | diss.rml.association.type.EXPERT |
| Tricalcium diarsenide | 235-509-9 | 12255-53-7 | diss.rml.association.type.EXPERT_ECHA |
| Sodium hexafluoroarsenate(V) | 624-772-9 | 12005-86-6 | diss.rml.association.type.EXPERT_ECHA |
| Benzenesulfonic acid, 4-arsenoso- | - | 71130-51-3 | diss.rml.association.type.EXPERT |
| Strychnidin-10-one, compd. with methylarsonate (1:1) | 279-614-8 | 80879-64-7 | diss.rml.association.type.EXPERT |
| Triphenylarsine oxide | 214-571-0 | 1153-05-5 | diss.rml.association.type.EXPERT |
| Zinc arsenide | - | 56450-43-2 | diss.rml.association.type.EXPERT |
| Iododimethylarsine | 211-630-2 | 676-75-5 | diss.rml.association.type.EXPERT |
| Trifluoroarsine | 232-060-0 | 7784-35-2 | diss.rml.association.type.EXPERT_ECHA |
| Tetraphenylarsonium (hydrogen dichloride) | 244-144-4 | 21006-73-5 | diss.rml.association.type.EXPERT |
| Manganese arsenide | 234-478-9 | 12005-95-7 | diss.rml.association.type.EXPERT_ECHA |
| Arsenous acid, titanium salt | - | 92278-94-9 | diss.rml.association.type.EXPERT |
| Tricalcium diarsenite | 248-266-9 | 27152-57-4 | diss.rml.association.type.EXPERT_ECHA |
| Arsonic acid, lead(2+) salt (1:1) | - | 109882-46-4 | diss.rml.association.type.EXPERT |
| Arsenenous acid, neodymium(3+) salt | - | 76871-63-1 | diss.rml.association.type.EXPERT |
| Boron arsenide (BAs) | - | 12005-69-5 | diss.rml.association.type.EXPERT |
| Arsorane, pentahydroxy-, copper(2+) salt (1:2) | - | - | diss.rml.association.type.EXPERT |
| Aluminium arsenide | 245-255-0 | 22831-42-1 | diss.rml.association.type.EXPERT_ECHA |
| Holmium arsenide | 234-476-8 | 12005-92-4 | diss.rml.association.type.EXPERT_ECHA |
| Arsonic acid, methyl-, iron salt (9CI) | - | 33972-75-7 | diss.rml.association.type.EXPERT |
| Melarsonyl potassium | 236-405-6 | 13355-00-5 | diss.rml.association.type.EXPERT |
| Arsonic acid, disodium salt | - | 13466-06-3 | diss.rml.association.type.EXPERT |
| Arsenic sulfide (As2S4) | - | - | diss.rml.association.type.EXPERT |
| Triphenylarsine | 210-032-9 | 603-32-7 | diss.rml.association.type.EXPERT |
|
Slimes and Sludges, copper refining
A complex combination resulting from copper processing---other than electrolytic.
|
266-977-2 | 67712-00-9 | diss.rml.association.type.EXPERT_ECHA |
| 2,2'-[ethylenebis(oxy)]bis[1,3,2-dioxarsolane] | 238-911-2 | 14849-23-1 | diss.rml.association.type.EXPERT |
| Trisodium arsenate | 236-682-3 | 13464-38-5 | diss.rml.association.type.EXPERT_ECHA |
| Iron tris(dimethylarsinate) | 227-759-2 | 5968-84-3 | diss.rml.association.type.EXPERT |
| 4-Aminophenylarsenoxide | - | 1122-90-3 | diss.rml.association.type.EXPERT |
| Hydrogen hexafluoroarsenate | 241-128-9 | 17068-85-8 | diss.rml.association.type.EXPERT_ECHA |
| Arsenenous acid, cadmium salt | - | 84953-43-5 | diss.rml.association.type.EXPERT |
| Silicic acid (H4SiO4), magnesium manganese(2+) zinc salt, arsenic and lead-doped | - | 68784-76-9 | diss.rml.association.type.EXPERT |
| o-phenylenediarsonic acid | 217-154-1 | 1758-48-1 | diss.rml.association.type.EXPERT |
| Copper acetoarsenite | 601-658-7 | 12002-03-8 | diss.rml.association.type.EXPERT |
| Arsenous acid, gallium salt (1:1) | - | 24343-41-7 | diss.rml.association.type.EXPERT |
| Arsenic trichloride | 232-059-5 | 7784-34-1 | diss.rml.association.type.EXPERT_ECHA |
| Arsenic selenide | - | 12626-31-2 | diss.rml.association.type.EXPERT |
| Trisodium 3-[(o-arsonatophenyl)azo]-4,5-dihydroxynaphthalene-2,7-disulphonate | 266-069-6 | 66019-20-3 | diss.rml.association.type.EXPERT |
| Arsenenous acid, cobalt(2+) salt | - | 85561-28-0 | diss.rml.association.type.EXPERT |
| Arsenic | 231-148-6 | 7440-38-2 | diss.rml.association.type.EXPERT_ECHA |
| 2-nitrophenylarsonic acid | 226-485-0 | 5410-29-7 | diss.rml.association.type.EXPERT |
| Arsenenous acid, antimony(3+) salt | - | 83877-96-7 | diss.rml.association.type.EXPERT |
| Trisodium arsenite | 236-681-8 | 13464-37-4 | diss.rml.association.type.EXPERT_ECHA |
| (Carboxymethyl)trimethylarsonium hydroxide inner salt | 634-697-3 | 64436-13-1 | diss.rml.association.type.EXPERT |
| Sodium oxidoarsonous acid | - | 60189-99-3 | diss.rml.association.type.EXPERT |
| Triethyl arsenate | 427-700-2 | 15606-95-8 | diss.rml.association.type.EXPERT |
| 4-(glycolloylamino)phenylarsonic acid | 205-643-2 | 144-87-6 | diss.rml.association.type.EXPERT |
| Trisilver arsenide | 235-652-7 | 12417-99-1 | diss.rml.association.type.EXPERT_ECHA |
| Arsenenous acid, cadmium neodymium(3+) salt (5:1:1) | - | 76871-66-4 | diss.rml.association.type.EXPERT |
| Arsenic acid (H3AsO4), calcium salt (4:5) | - | 89067-81-2 | diss.rml.association.type.EXPERT |
| Sodium hydrogen (3-acetamido-4-hydroxyphenyl)arsonate | 227-573-1 | 5892-48-8 | diss.rml.association.type.EXPERT |
| Arsenous acid, zinc salt (2:3) | - | 28837-97-0 | diss.rml.association.type.EXPERT |
| Arsenic acid (H3AsO4), lead salt | - | 7645-25-2 | diss.rml.association.type.EXPERT |
| Trilead diarsenate | 222-979-5 | 3687-31-8 | diss.rml.association.type.EXPERT_ECHA |
| Tetraphenylarsonium Chloride Hydrochloride Hydrate | 621-302-4 | 123334-18-9 | diss.rml.association.type.EXPERT |
| Arsenous acid, lead(2+) salt (1:1) | - | 100822-74-0 | diss.rml.association.type.EXPERT |
| Phenylarsine oxide | 211-275-3 | 637-03-6 | diss.rml.association.type.EXPERT_ECHA |
| Arsenic acid (H3AsO4), bismuth salt (1:1) | - | 13702-38-0 | diss.rml.association.type.EXPERT |
| Tricopper arsenide | 234-472-6 | 12005-75-3 | diss.rml.association.type.EXPERT_ECHA |
| Gallium zinc triarsenide | 308-577-3 | 98106-56-0 | diss.rml.association.type.EXPERT_ECHA |
| Silicic acid (H4SiO4), tetraethyl ester, polymer with arsenic oxide (As2O3) | - | 68957-75-5 | diss.rml.association.type.EXPERT |
| Iron bis(arsenate) | 233-275-2 | 10102-50-8 | diss.rml.association.type.EXPERT_ECHA |
| Manganese arsenate | - | 27526-45-0 | diss.rml.association.type.EXPERT |
| Trisodium arsenide | 234-952-5 | 12044-25-6 | diss.rml.association.type.EXPERT_ECHA |
| Calcium arsenite | 258-147-3 | 52740-16-6 | diss.rml.association.type.EXPERT |
| Disodium 3,6-bis[(o-arsonophenyl)azo]-4,5-dihydroxynaphthalene-2,7-disulphonate | 263-516-7 | 62337-00-2 | diss.rml.association.type.EXPERT_ECHA |
| Dimethylarsinic acid | 200-883-4 | 75-60-5 | diss.rml.association.type.EXPERT_ECHA |
| Arsenic acid (H3AsO4), magnesium salt (2:3) | - | 21480-65-9 | diss.rml.association.type.EXPERT |
| Praseodymium arsenide | 234-953-0 | 12044-28-9 | diss.rml.association.type.EXPERT_ECHA |
| Arsthinol | 204-361-7 | 119-96-0 | diss.rml.association.type.EXPERT |
| Zinc arsenenate oxide (Zn5(AsO3)4O3), tetrahydrate | - | 1303-39-5 | diss.rml.association.type.EXPERT |
| Diarsenic trioxide | 215-481-4 | 1327-53-3 | diss.rml.association.type.EXPERT_ECHA |
| (4-((2-Amino-2-oxoethyl)amino)phenyl)arsonic acid | - | 618-25-7 | diss.rml.association.type.EXPERT |
|
Flue dust, arsenic-contg.
Formed when arsenic and metal oxide particles are driven off during the roasting and converting of copper concentrates and matte in the production of anode copper.
|
232-434-3 | 8028-73-7 | diss.rml.association.type.EXPERT_ECHA |
| Iron diarsenide | 234-485-7 | 12006-21-2 | diss.rml.association.type.EXPERT_ECHA |
| [2-(diphenylarsino)ethyl]diphenylphosphine | 245-758-5 | 23582-06-1 | diss.rml.association.type.EXPERT |
| Pentafluoroarsorane | 232-061-6 | 7784-36-3 | diss.rml.association.type.EXPERT_ECHA |
| Ytterbium arsenide | 234-483-6 | 12006-12-1 | diss.rml.association.type.EXPERT_ECHA |
| Arsenenous acid, ammonium zinc salt | - | 94854-80-5 | diss.rml.association.type.EXPERT |
| Neodymium arsenide | 235-504-1 | 12255-09-3 | diss.rml.association.type.EXPERT_ECHA |
| Arsine | 232-066-3 | 7784-42-1 | diss.rml.association.type.EXPERT |
| Tristrontium diarsenide | 254-407-5 | 39297-24-0 | diss.rml.association.type.EXPERT_ECHA |
| Iron arsenide | - | 39310-41-3 | diss.rml.association.type.EXPERT |
| Arsenic trichloride | - | 60646-36-8 | diss.rml.association.type.EXPERT |
| 3-formamido-4-hydroxyphenylarsonic acid | 262-085-2 | 60154-16-7 | diss.rml.association.type.EXPERT |
| Difetarsone | 222-866-0 | 3639-19-8 | diss.rml.association.type.EXPERT |
| Strychnine arsenate | 233-970-0 | 10476-82-1 | diss.rml.association.type.EXPERT_ECHA |
| Methyloxoarsine | 209-799-2 | 593-58-8 | diss.rml.association.type.EXPERT |
| Arsenenous acid, calcium salt (2:1) | - | 15194-98-6 | diss.rml.association.type.EXPERT |
| Oxophenarsine hydrochloride | 208-682-3 | 538-03-4 | diss.rml.association.type.EXPERT_ECHA |
| Pentahydroxyarsorane | 232-096-7 | 7786-36-9 | diss.rml.association.type.EXPERT_ECHA |
| Arsenic acid, calcium salt | 233-287-8 | 10103-62-5 | diss.rml.association.type.EXPERT_ECHA |
| Arsenic oxide | - | 12777-38-7 | diss.rml.association.type.EXPERT |
| Trilithium arsenide | 234-950-4 | 12044-22-3 | diss.rml.association.type.EXPERT_ECHA |
| Disilver arsenide | 274-573-2 | 70333-07-2 | diss.rml.association.type.EXPERT_ECHA |
| Lithium hexafluoroarsenate | 249-963-0 | 29935-35-1 | diss.rml.association.type.EXPERT_ECHA |
| Gallium arsenide | 215-114-8 | 1303-00-0 | diss.rml.association.type.EXPERT_ECHA |
| Arsenic acid (H3AsO4), lead(4+) salt (3:2) | - | 10102-48-4 | diss.rml.association.type.EXPERT |
| Arsenic acid, magnesium salt | 233-285-7 | 10103-50-1 | diss.rml.association.type.EXPERT_ECHA |
| Terbium arsenide | 234-479-4 | 12006-08-5 | diss.rml.association.type.EXPERT_ECHA |
| Tribarium diarsenide | 235-508-3 | 12255-50-4 | diss.rml.association.type.EXPERT_ECHA |
|
Lead alloy, base, dross
A scum formed on the surface of molten lead-base alloys. Includes those cases in which aluminum is used to remove arsenic, nickel and antimony.
|
273-700-9 | 69011-59-2 | diss.rml.association.type.EXPERT_ECHA |
| Thallium arsenide | 234-481-5 | 12006-09-6 | diss.rml.association.type.EXPERT_ECHA |
| Arsenic sulfide (AsS2) | - | 56320-22-0 | diss.rml.association.type.EXPERT |
| Arsenazo III sodium | 630-782-4 | 138608-19-2 | diss.rml.association.type.EXPERT |
| 2-aminophenylarsonic acid | 218-064-5 | 2045-00-3 | diss.rml.association.type.EXPERT |
| Trisilver arsenate | 236-841-7 | 13510-44-6 | diss.rml.association.type.EXPERT_ECHA |
| Trizinc diarsenide | 234-486-2 | 12006-40-5 | diss.rml.association.type.EXPERT_ECHA |
| Arsenenous acid, lutetium(3+) salt | - | 76871-65-3 | diss.rml.association.type.EXPERT |
| Nitarsone | 202-695-8 | 98-72-6 | diss.rml.association.type.EXPERT |
| Arsenic tribromide | 232-057-4 | 7784-33-0 | diss.rml.association.type.EXPERT_ECHA |
| Ferric arsenite, basic | - | 63989-69-5 | diss.rml.association.type.EXPERT |
| Tryparsamide | 209-070-9 | 554-72-3 | diss.rml.association.type.EXPERT |
| Tin arsenide (SnAs) | - | 12044-32-5 | diss.rml.association.type.EXPERT |
| Arsenic acid, copper salt | 233-286-2 | 10103-61-4 | diss.rml.association.type.EXPERT_ECHA |
| Sodium 4-(glycolloylamino)phenylarsonate | 231-680-9 | 7681-83-6 | diss.rml.association.type.EXPERT |
| Arsine oxide, dichloro(2-chlorovinyl)- | - | 333-25-5 | diss.rml.association.type.EXPERT |
| Zinc arsenate | 236-683-9 | 13464-44-3 | diss.rml.association.type.EXPERT_ECHA |
| Carbarsone | 204-484-6 | 121-59-5 | diss.rml.association.type.EXPERT |
| Phenylarsonic acid | 202-631-9 | 98-05-5 | diss.rml.association.type.EXPERT |
| Sodium p-arsonobenzenesulphonate | 229-632-7 | 6634-88-4 | diss.rml.association.type.EXPERT |
| Oxophenarsine | 206-178-8 | 306-12-7 | diss.rml.association.type.EXPERT_ECHA |
| Digallium arsenide phosphide | 234-948-3 | 12044-20-1 | diss.rml.association.type.EXPERT_ECHA |
|
Lead, antimonial, dross
A scum formed on the surface of antimonial lead. Consists primarily of sodium arsenate and sodium antimonate with some lead oxide and free caustic soda.
|
273-795-7 | 69029-51-2 | diss.rml.association.type.EXPERT_ECHA |
| Arsenous acid, tricopper(1+) salt | - | 33382-64-8 | diss.rml.association.type.EXPERT |
| Arsenic acid (H3AsO4), calcium salt (7:10) | - | 85949-61-7 | diss.rml.association.type.EXPERT |
| Copper diarsenite | 240-574-1 | 16509-22-1 | diss.rml.association.type.EXPERT_ECHA |
| Disodium 3-[(o-arsonophenyl)azo]-4,5-dihydroxynaphthalene-2,7-disulphonate | 222-600-3 | 3547-38-4 | diss.rml.association.type.EXPERT |
| Strychnidin-10-one, arsenite (1:1) | 309-388-9 | 100258-44-4 | diss.rml.association.type.EXPERT_ECHA |
| Calcium bis(methylarsonate) | 227-598-8 | 5902-95-4 | diss.rml.association.type.EXPERT |
| Cobalt arsenide | 248-168-6 | 27016-73-5 | diss.rml.association.type.EXPERT_ECHA |
| arsenic acid, calcium salt | - | 89054-07-9 | diss.rml.association.type.EXPERT |
| Triammonium arsenate | 246-428-3 | 24719-13-9 | diss.rml.association.type.EXPERT_ECHA |
| Sulfarsphenamine | 210-564-1 | 618-82-6 | diss.rml.association.type.EXPERT_ECHA |
| Trisilver arsenite | 232-048-5 | 7784-08-9 | diss.rml.association.type.EXPERT_ECHA |
| 4-acetamidophenylarsonic acid | 210-541-6 | 618-22-4 | diss.rml.association.type.EXPERT |
| Aluminium gallium arsenide | 680-872-2 | 37382-15-3 | diss.rml.association.type.EXPERT |
| Strontium arsenite (Sr(As2O4)) | - | 91724-16-2 | diss.rml.association.type.EXPERT |
| Sodium hydrogen [4-(acetamido)phenyl]arsonate | 209-558-1 | 585-54-6 | diss.rml.association.type.EXPERT |
| Cobalt arsenide | 265-784-0 | 65453-05-6 | diss.rml.association.type.EXPERT_ECHA |
| 4-hydroxyphenylarsonic acid | 202-641-3 | 98-14-6 | diss.rml.association.type.EXPERT |
| Lanthanum arsenide | 235-502-0 | 12255-04-8 | diss.rml.association.type.EXPERT_ECHA |
| Indium arsenide | 215-115-3 | 1303-11-3 | diss.rml.association.type.EXPERT_ECHA |
| Lutetium arsenide | 234-477-3 | 12005-94-6 | diss.rml.association.type.EXPERT_ECHA |
| Arsenic acid (H3AsO4), ammonium salt (2:1) | - | 127795-79-3 | diss.rml.association.type.EXPERT |
| Dibismuth tris(methylarsonate) | 286-401-3 | 85237-42-9 | diss.rml.association.type.EXPERT |
| Tetraarsenic trisulfide | - | 12512-13-9 | diss.rml.association.type.EXPERT |
| Diphenyliodonium hexafluoroarsenate | 263-638-0 | 62613-15-4 | diss.rml.association.type.EXPERT_ECHA |
| Chlorotris(triphenylarsine)rhodium | 239-051-0 | 14973-92-3 | diss.rml.association.type.EXPERT |
| Arsonic acid, methyl-, compd. with 1-octanamine (1:1) | - | 6379-37-9 | diss.rml.association.type.EXPERT |
| Arsenenous acid, lithium salt | - | 72845-34-2 | diss.rml.association.type.EXPERT |
| Arsenic triiodide | 232-068-4 | 7784-45-4 | diss.rml.association.type.EXPERT_ECHA |
| Gallium arsenic phosphide | - | 60953-19-7 | diss.rml.association.type.EXPERT |
| Arsenic(II) sulfide | - | 12044-79-0 | diss.rml.association.type.EXPERT |
| Arsenic pentachloride | - | 22441-45-8 | diss.rml.association.type.EXPERT |
| Disodium 4-[(o-arsonophenyl)azo]-3-hydroxynaphthalene-2,7-disulphonate | 222-993-1 | 3688-92-4 | diss.rml.association.type.EXPERT_ECHA |
| Tetraphenylarsonium bromide | 208-069-0 | 507-27-7 | diss.rml.association.type.EXPERT |
| Silver hexafluoroarsenate | 624-776-0 | 12005-82-2 | diss.rml.association.type.EXPERT |
| Arsenenous acid, ammonium copper salt | - | 94854-78-1 | diss.rml.association.type.EXPERT |
| Zinc arsenate, octahydrate | - | 13510-72-0 | diss.rml.association.type.EXPERT |
| Methylenebis(diphenylarsine) | 244-639-5 | 21892-63-7 | diss.rml.association.type.EXPERT |
|
Slimes and Sludges, copper-lead ore roasting off gas scrubbing, arsenic-contg.
The product obtained by the purification of copper-lead ore concentrate roasting offgas. Composed primarily of arsenic oxide (As2O3).
|
310-063-9 | 102110-62-3 | diss.rml.association.type.EXPERT_ECHA |
| Diarsenic triselenide | 215-119-5 | 1303-36-2 | diss.rml.association.type.EXPERT_ECHA |
| Bromo(hydroxytetraphenylarsoranato)magnesium | 264-254-6 | 63468-73-5 | diss.rml.association.type.EXPERT |
| Disodium arsonoacetate | 204-806-5 | 126-82-9 | diss.rml.association.type.EXPERT |
| iron;iron(3+);methyl-dioxido-oxo-$l^{5}-arsane | - | 6585-53-1 | diss.rml.association.type.EXPERT |
| Arsenic chloride | - | 37226-49-6 | diss.rml.association.type.EXPERT |
| Trimanganese arsenide | 262-667-6 | 61219-26-9 | diss.rml.association.type.EXPERT_ECHA |
| Arsanilic acid | 202-674-3 | 98-50-0 | diss.rml.association.type.EXPERT |
| Zirconium arsenide | 262-524-8 | 60909-47-9 | diss.rml.association.type.EXPERT_ECHA |
| Arsenous acid, antimony(3+) salt (1:1) | - | 12523-20-5 | diss.rml.association.type.EXPERT |
| Arsine, dichloromethyl- | 695-189-5 | 593-89-5 | diss.rml.association.type.EXPERT |
| 3-amino-4-hydroxyphenylarsonic acid | 218-494-3 | 2163-77-1 | diss.rml.association.type.EXPERT |
| Ammonium dihydrogenarsenate | 236-667-1 | 13462-93-6 | diss.rml.association.type.EXPERT_ECHA |
| Nickel diarsenide | 235-103-1 | 12068-61-0 | diss.rml.association.type.EXPERT_ECHA |
| Tricobalt diarsenate | 246-429-9 | 24719-19-5 | diss.rml.association.type.EXPERT_ECHA |
| Niobium arsenide | 235-503-6 | 12255-08-2 | diss.rml.association.type.EXPERT_ECHA |
| Samarium arsenide | 235-506-2 | 12255-39-9 | diss.rml.association.type.EXPERT_ECHA |
| Arsenenous acid, silver(1+) salt | - | 69507-43-3 | diss.rml.association.type.EXPERT |
| Dichloro(phenyl)arsine | 211-791-9 | 696-28-6 | diss.rml.association.type.EXPERT |
| 10-chloro-10H-phenoxarsine | 220-684-6 | 2865-70-5 | diss.rml.association.type.EXPERT |
| Diphenyldiarsenic acid | 224-845-1 | 4519-32-8 | diss.rml.association.type.EXPERT_ECHA |
| Sodium methylarsonate | 218-495-9 | 2163-80-6 | diss.rml.association.type.EXPERT |
| Arsenic acid (H3AsO4), cobalt(2+) salt | - | 29871-10-1 | diss.rml.association.type.EXPERT |
| Arsonic acid, tin salt | - | 93080-00-3 | diss.rml.association.type.EXPERT |
| Melarsoprol | 207-793-4 | 494-79-1 | diss.rml.association.type.EXPERT |
| Arsenic sulfide (As2S5) | 625-728-1 | 1303-34-0 | diss.rml.association.type.EXPERT |
| Trimethylarsine | 209-815-8 | 593-88-4 | diss.rml.association.type.EXPERT |
| Trisodium 4-[(o-arsonophenyl)azo]-3-oxidonaphthalene-2,7-disulphonate | 258-693-2 | 53669-45-7 | diss.rml.association.type.EXPERT |
| Magnesium arsenate, decahydrate | - | 117746-50-6 | diss.rml.association.type.EXPERT |
| trisodium;trioxido(oxo)-$l^{5}-arsane;dodecahydrate | - | 13510-46-8 | diss.rml.association.type.EXPERT |
| Arsenenous acid, nickel(2+) salt | - | 33992-49-3 | diss.rml.association.type.EXPERT |
| Calcium arsenate | 231-904-5 | 7778-44-1 | diss.rml.association.type.EXPERT_ECHA |
| Trimagnesium diarsenide | 234-954-6 | 12044-49-4 | diss.rml.association.type.EXPERT_ECHA |
| 4-(ethylamino)-2-methylbenzenediazonium hexafluoroarsenate | 264-026-6 | 63217-32-3 | diss.rml.association.type.EXPERT_ECHA |
| Arsenic chloride (AsCl2) | - | 41996-37-6 | diss.rml.association.type.EXPERT |
| Diarsenic pentaoxide | 215-116-9 | 1303-28-2 | diss.rml.association.type.EXPERT_ECHA |
| Arsenic acid (H3AsO4), lead(2+) salt (4:5) | - | 89054-03-5 | diss.rml.association.type.EXPERT |
| 2-[[7-[(2-arsonophenyl)azo]-1,8-dihydroxy-3,6-disulpho-2-naphthyl]azo]benzoic acid | 223-216-9 | 3772-44-9 | diss.rml.association.type.EXPERT |
| Gadolinium arsenide | 234-475-2 | 12005-89-9 | diss.rml.association.type.EXPERT_ECHA |
| Tripotassium arsenate 3/2hydrate | - | 62702-52-7 | diss.rml.association.type.EXPERT |
| Gallium arsenide phosphide | - | 106097-61-4 | diss.rml.association.type.EXPERT |
| Potassium arsenite | 236-680-2 | 13464-35-2 | diss.rml.association.type.EXPERT_ECHA |
| Antimony arsenic oxide | 264-904-9 | 64475-90-7 | diss.rml.association.type.EXPERT_ECHA |
| Sodium metaarsenate | 239-171-3 | 15120-17-9 | diss.rml.association.type.EXPERT_ECHA |
| p-tolylarsonic acid | 223-588-2 | 3969-54-8 | diss.rml.association.type.EXPERT |
| Arsenic acid (H3AsO4), copper(2+) salt (4:5) | - | 89054-01-3 | diss.rml.association.type.EXPERT |
| Diarsenic acid, sodium salt | - | 13464-42-1 | diss.rml.association.type.EXPERT |
| 2,7-(bis(2-arsonophenylazo))-1,8-dihydroxynaphthalene-3,6-disulphonic acid | 216-788-6 | 1668-00-4 | diss.rml.association.type.EXPERT |
|
Flue dust, lead-refining
By-product of refining lead ores obtained from baghouse and electro-static precipitator and as slurry from scrubbers.
|
273-809-1 | 69029-67-0 | diss.rml.association.type.EXPERT_ECHA |
| (4-aminophenyl)arsonic acid, compound with piperazine (1:1) | 303-952-8 | 94232-26-5 | diss.rml.association.type.EXPERT |
| Rammelsbergite (NiAs2) | - | 1303-22-6 | diss.rml.association.type.EXPERT |
| Lead arsenite | 233-083-9 | 10031-13-7 | diss.rml.association.type.EXPERT_ECHA |
| 2,6-dimethyl-4-phenylpyrylium hexafluoroarsenate | 282-700-8 | 84304-15-4 | diss.rml.association.type.EXPERT_ECHA |
| Arsenous acid | - | 13464-58-9 | diss.rml.association.type.EXPERT |
|
Slimes and Sludges, copper electrolytic refining, decopperized, arsenic-rich
Product obtained by centrifuging the slime discharged at the bases of cells for decopperization of electrolytic copper solutions. Composed primarily of a copper powder rich in arsenic.
|
309-772-6 | 100995-81-1 | diss.rml.association.type.EXPERT_ECHA |
| Arsenic sulfide | 215-117-4 | 1303-33-9 | diss.rml.association.type.EXPERT_ECHA |
| Boron arsenide (B6As) | - | 12005-70-8 | diss.rml.association.type.EXPERT |
| Arsenic bromide | 265-296-8 | 64973-06-4 | diss.rml.association.type.EXPERT_ECHA |
| Arsine, bis(2-chlorovinyl)chloro- | - | 40334-69-8 | diss.rml.association.type.EXPERT |
| Disodium methylarsonate | 205-620-7 | 144-21-8 | diss.rml.association.type.EXPERT |
| Trisodium 2-(-hydrogen arsonatophenylazo)-1,8-dihydroxynaphthalene-3,6-disulphonate | 208-285-5 | 520-10-5 | diss.rml.association.type.EXPERT |
| Manganese arsenide (Mn2As) | - | 12005-96-8 | diss.rml.association.type.EXPERT |
| Tin arsenide (Sn4As3) | - | 12397-66-9 | diss.rml.association.type.EXPERT |
| Copper arsonate | 233-644-8 | 10290-12-7 | diss.rml.association.type.EXPERT |
| Germanium arsenide | 235-547-6 | 12271-72-6 | diss.rml.association.type.EXPERT_ECHA |
| Neoarsphenamine | 207-273-7 | 457-60-3 | diss.rml.association.type.EXPERT_ECHA |
| Dysprosium arsenide | 234-473-1 | 12005-81-1 | diss.rml.association.type.EXPERT_ECHA |
| Methyl 1,2,5,6-tetrahydro-1-methylnicotinate, mono[(3-acetamido-4-hydroxyphenyl)arsonate] | 212-983-5 | 900-77-6 | diss.rml.association.type.EXPERT |
| Disodium [4-[(4,6-diamino-1,3,5-triazin-2-yl)amino]phenyl]arsonate | 222-749-4 | 3599-28-8 | diss.rml.association.type.EXPERT |
| N-(p-arsenosophenyl)-1,3,5-triazine-2,4,6-triamine | 244-612-8 | 21840-08-4 | diss.rml.association.type.EXPERT_ECHA |
| Arsenenic acid | - | 10102-53-1 | diss.rml.association.type.EXPERT |
| 3-methyl-4-(pyrrolidin-1-yl)benzenediazonium hexafluoroarsenate | 248-532-4 | 27569-09-1 | diss.rml.association.type.EXPERT_ECHA |
| Glycobiarsol | 204-143-1 | 116-49-4 | diss.rml.association.type.EXPERT |
| Mercury hydrogenarsenate | 232-062-1 | 7784-37-4 | diss.rml.association.type.EXPERT_ECHA |
EU Privacy Disclaimer
This website uses cookies to ensure you get the best experience on our websites.