dangerous-subs-eco-labels
dangerous-subs-eco-labels
Ecolabels - Restrictions for Hazardous Substances/Mixtures
This list contains a non-exhaustive inventory of substances based on the list of hazardous substances with harmonised classification and labelling (i.e. Table 3 of Annex VI to the CLP Regulation), and the Candidate List of substances of very high concern (SVHCs). Pursuant to Article 6(6) of the EU Ecolabel Regulation, the ecolabel must not be awarded to goods containing substances or mixtures classified according to the CLP as toxic; hazardous to the environment; and carcinogenic, mutagenic, or toxic for reproduction (CMRs). Nor are products allowed the ecolabel award when they contain SVHCs (per Article 57 of REACH). While the CLP's harmonised list contains many such substances, other ones not listed in Table 3 may also meet the criteria specified for classification under the CLP.
arsenic compounds, with the exception of those specified elsewhere in this Annex
ecnumber: - casnumber: -| Table 3 of Annex VI to CLP |
yes
|
Help
Group members
substance-members-text
Results list is empty
| Name | EC / List no. | CAS no. | Association |
|---|---|---|---|
| Cobalt arsenide | 248-168-6 | 27016-73-5 | diss.rml.association.type.EXPERT_ECHA |
| Tribarium diarsenide | 235-508-3 | 12255-50-4 | diss.rml.association.type.EXPERT_ECHA |
| Diphenyliodonium hexafluoroarsenate | 263-638-0 | 62613-15-4 | diss.rml.association.type.EXPERT_ECHA |
| Lead hydrogen arsenate | 232-064-2 | 7784-40-9 | diss.rml.association.type.EXPERT_ECHA |
| Tetramethyldiarsine | 207-440-4 | 471-35-2 | diss.rml.association.type.EXPERT |
| Trisodium 2-(-hydrogen arsonatophenylazo)-1,8-dihydroxynaphthalene-3,6-disulphonate | 208-285-5 | 520-10-5 | diss.rml.association.type.EXPERT |
| Triethylarsine | 210-526-4 | 617-75-4 | diss.rml.association.type.EXPERT |
| Trisilver arsenate | 236-841-7 | 13510-44-6 | diss.rml.association.type.EXPERT_ECHA |
| Arsenous acid, tripotassium salt | - | 36267-15-9 | diss.rml.association.type.EXPERT |
| Lead arsenite | 233-083-9 | 10031-13-7 | diss.rml.association.type.EXPERT_ECHA |
| Nickel arsenide | - | 12795-30-1 | diss.rml.association.type.EXPERT |
| Dimethylarsinic acid | 200-883-4 | 75-60-5 | diss.rml.association.type.EXPERT_ECHA |
| Arsenic trichloride | 232-059-5 | 7784-34-1 | diss.rml.association.type.EXPERT_ECHA |
| Arsenic sulfide | 235-720-6 | 12612-21-4 | diss.rml.association.type.EXPERT_ECHA |
| Yttrium arsenide | 235-507-8 | 12255-48-0 | diss.rml.association.type.EXPERT_ECHA |
| arsenic acid, calcium salt | - | 89054-07-9 | diss.rml.association.type.EXPERT |
| Pentafluoroarsorane | 232-061-6 | 7784-36-3 | diss.rml.association.type.EXPERT_ECHA |
| (4-((2-Amino-2-oxoethyl)amino)phenyl)arsonic acid | - | 618-25-7 | diss.rml.association.type.EXPERT |
|
Slimes and Sludges, copper refining
A complex combination resulting from copper processing---other than electrolytic.
|
266-977-2 | 67712-00-9 | diss.rml.association.type.EXPERT_ECHA |
| 6,6'-dihydroxy-3,3'-diarsene-1,2-diyldianilinium dichloride | 205-386-6 | 139-93-5 | diss.rml.association.type.EXPERT_ECHA |
| Nickel diarsenide | 235-103-1 | 12068-61-0 | diss.rml.association.type.EXPERT_ECHA |
| Oxophenarsine hydrochloride | 208-682-3 | 538-03-4 | diss.rml.association.type.EXPERT_ECHA |
| Trilithium arsenide | 234-950-4 | 12044-22-3 | diss.rml.association.type.EXPERT_ECHA |
| Arsenic acid, copper salt | 233-286-2 | 10103-61-4 | diss.rml.association.type.EXPERT_ECHA |
| Arsenic acid (H3AsO4), copper(2+) salt (4:5) | - | 89054-01-3 | diss.rml.association.type.EXPERT |
| Arsenic chloride (AsCl) | - | 17522-78-0 | diss.rml.association.type.EXPERT |
| Diammonium hydrogenarsenate | 232-067-9 | 7784-44-3 | diss.rml.association.type.EXPERT_ECHA |
| Arsonate | - | 36465-76-6 | diss.rml.association.type.EXPERT |
| Dysprosium arsenide | 234-473-1 | 12005-81-1 | diss.rml.association.type.EXPERT_ECHA |
| Trilithium arsenate | 236-773-8 | 13478-14-3 | diss.rml.association.type.EXPERT_ECHA |
| Arsonic acid, disodium salt | - | 13466-06-3 | diss.rml.association.type.EXPERT |
| Trisodium arsenate | 236-682-3 | 13464-38-5 | diss.rml.association.type.EXPERT_ECHA |
| Arsenenous acid, ammonium zinc salt | - | 94854-80-5 | diss.rml.association.type.EXPERT |
| Diarsenic tritelluride | 234-955-1 | 12044-54-1 | diss.rml.association.type.EXPERT_ECHA |
| Trizinc diarsenide | 234-486-2 | 12006-40-5 | diss.rml.association.type.EXPERT_ECHA |
| Disodium arsonoacetate | 204-806-5 | 126-82-9 | diss.rml.association.type.EXPERT |
| Gallium zinc triarsenide | 308-577-3 | 98106-56-0 | diss.rml.association.type.EXPERT_ECHA |
| Trifluoroarsine | 232-060-0 | 7784-35-2 | diss.rml.association.type.EXPERT_ECHA |
| Tris[(8α,9R)-6'-methoxycinchonan-9-ol] bis(arsenate) | 208-971-4 | 549-59-7 | diss.rml.association.type.EXPERT_ECHA |
| Diphenyldiarsenic acid | 224-845-1 | 4519-32-8 | diss.rml.association.type.EXPERT_ECHA |
|
Lead, antimonial, dross
A scum formed on the surface of antimonial lead. Consists primarily of sodium arsenate and sodium antimonate with some lead oxide and free caustic soda.
|
273-795-7 | 69029-51-2 | diss.rml.association.type.EXPERT_ECHA |
| Arsenic acid (H3AsO4), monosodium salt | - | 10103-60-3 | diss.rml.association.type.EXPERT |
| Diarsenic trioxide | 215-481-4 | 1327-53-3 | diss.rml.association.type.EXPERT_ECHA |
| Potassium dihydrogenarsenate | 232-065-8 | 7784-41-0 | diss.rml.association.type.EXPERT_ECHA |
| Bromo(hydroxytetraphenylarsoranato)magnesium | 264-254-6 | 63468-73-5 | diss.rml.association.type.EXPERT |
| (2-Chloroethenyl)arsonous dichloride | - | 541-25-3 | diss.rml.association.type.EXPERT |
| Magnesium arsenate, decahydrate | - | 117746-50-6 | diss.rml.association.type.EXPERT |
| Arsenic sulfide (As2S5) | 625-728-1 | 1303-34-0 | diss.rml.association.type.EXPERT |
| 4-(4-dimethylaminophenylazo)phenylarsonic acid | 210-750-2 | 622-68-4 | diss.rml.association.type.EXPERT |
| Antimony oxide (Sb2O3), mixed with arsenic oxide (As2O3) | 273-156-2 | 68951-38-2 | diss.rml.association.type.EXPERT_ECHA |
| Propylarsonic acid | 203-482-2 | 107-34-6 | diss.rml.association.type.EXPERT |
| Iron diarsenide | 234-485-7 | 12006-21-2 | diss.rml.association.type.EXPERT_ECHA |
| Arsenenous acid, mercury(2+) salt | - | 82980-40-3 | diss.rml.association.type.EXPERT |
| ARSENIC(V) OXIDE HYDRATE | 629-626-8 | 12044-50-7 | diss.rml.association.type.EXPERT |
| Ammonium magnesium arsenate | - | 14644-70-3 | diss.rml.association.type.EXPERT |
| Arsenic | 231-148-6 | 7440-38-2 | diss.rml.association.type.EXPERT_ECHA |
| Trisodium 3-[(o-arsonatophenyl)azo]-4,5-dihydroxynaphthalene-2,7-disulphonate | 266-069-6 | 66019-20-3 | diss.rml.association.type.EXPERT |
| Indium arsenide | 215-115-3 | 1303-11-3 | diss.rml.association.type.EXPERT_ECHA |
| Zinc diarsenide | 234-956-7 | 12044-55-2 | diss.rml.association.type.EXPERT_ECHA |
| Disodium 3,6-bis[[2-[(dihydroxyarsino)oxy]phenyl]azo]-4,5-dihydroxynaphthalene-2,7-disulphonate | 282-453-6 | 84215-47-4 | diss.rml.association.type.EXPERT |
| Methyltriphenylarsonium iodide | 216-108-8 | 1499-33-8 | diss.rml.association.type.EXPERT |
| Manganese arsenide | 234-478-9 | 12005-95-7 | diss.rml.association.type.EXPERT_ECHA |
| Aluminium arsenide | 245-255-0 | 22831-42-1 | diss.rml.association.type.EXPERT_ECHA |
| Platinum arsenide (PtAs2) | - | 12044-52-9 | diss.rml.association.type.EXPERT |
| Arsenic acid (H3AsO4), copper(2+) salt (2:3) | - | - | diss.rml.association.type.EXPERT |
| Arsenic acid (H3AsO4), lead salt | - | 7645-25-2 | diss.rml.association.type.EXPERT |
| Copper acetoarsenite | 601-658-7 | 12002-03-8 | diss.rml.association.type.EXPERT |
| Ethylenebis(diphenylarsine) | 224-629-7 | 4431-24-7 | diss.rml.association.type.EXPERT |
| Zinc arsenate | 236-683-9 | 13464-44-3 | diss.rml.association.type.EXPERT_ECHA |
| Pentahydroxyarsorane | 232-096-7 | 7786-36-9 | diss.rml.association.type.EXPERT_ECHA |
| Acetarsol sodium | 259-714-8 | 55588-51-7 | diss.rml.association.type.EXPERT |
| Proustite (Ag3(AsS3)) | 239-179-7 | 15122-58-4 | diss.rml.association.type.EXPERT |
| ARSENIC ACID (H3ASO4), HEMIHYDRATE | - | 7774-41-6 | diss.rml.association.type.EXPERT |
| Strontium arsenide (SrAs3) | - | 61462-16-6 | diss.rml.association.type.EXPERT |
| Trisilver arsenite | 232-048-5 | 7784-08-9 | diss.rml.association.type.EXPERT_ECHA |
| Arsenenous acid, cadmium neodymium(3+) salt (5:1:1) | - | 76871-66-4 | diss.rml.association.type.EXPERT |
| Arsenic acid (H3AsO4), copper(2+) salt (1:1) | - | 13464-31-8 | diss.rml.association.type.EXPERT |
| iron;iron(3+);methyl-dioxido-oxo-$l^{5}-arsane | - | 6585-53-1 | diss.rml.association.type.EXPERT |
| Methyloxoarsine | 209-799-2 | 593-58-8 | diss.rml.association.type.EXPERT |
| Diarsenic acid | - | 13453-15-1 | diss.rml.association.type.EXPERT |
| Trisodium arsenide | 234-952-5 | 12044-25-6 | diss.rml.association.type.EXPERT_ECHA |
| 4-(ethylamino)-2-methylbenzenediazonium hexafluoroarsenate | 264-026-6 | 63217-32-3 | diss.rml.association.type.EXPERT_ECHA |
| Arsenic acid, magnesium salt | 233-285-7 | 10103-50-1 | diss.rml.association.type.EXPERT_ECHA |
| Manganese arsenide (Mn2As) | - | 12005-96-8 | diss.rml.association.type.EXPERT |
| 4-(4-aminophenylazo)phenylarsonic acid | 230-176-6 | 6966-64-9 | diss.rml.association.type.EXPERT |
| Boron arsenate | - | 13510-31-1 | diss.rml.association.type.EXPERT |
| Calcium arsenate (CaHAsO4) (6CI,7CI) | 672-782-7 | 15195-00-3 | diss.rml.association.type.EXPERT |
| Nickel arsenide | 248-169-1 | 27016-75-7 | diss.rml.association.type.EXPERT_ECHA |
| 4-(glycolloylamino)phenylarsonic acid | 205-643-2 | 144-87-6 | diss.rml.association.type.EXPERT |
| 2-nitrophenylarsonic acid | 226-485-0 | 5410-29-7 | diss.rml.association.type.EXPERT |
| Arsenic acid, calcium salt | 233-287-8 | 10103-62-5 | diss.rml.association.type.EXPERT_ECHA |
| Triammonium arsenate | 246-428-3 | 24719-13-9 | diss.rml.association.type.EXPERT_ECHA |
| Iron bis(arsenate) | 233-275-2 | 10102-50-8 | diss.rml.association.type.EXPERT_ECHA |
| Arsenous acid, zinc salt (2:3) | - | 28837-97-0 | diss.rml.association.type.EXPERT |
| Samarium arsenide | 235-506-2 | 12255-39-9 | diss.rml.association.type.EXPERT_ECHA |
| Tetraarsenic tetrasulfide | - | 12279-90-2 | diss.rml.association.type.EXPERT |
| Erbium arsenide | 235-501-5 | 12254-88-5 | diss.rml.association.type.EXPERT_ECHA |
| Arsenenous acid, antimony(3+) salt | - | 83877-96-7 | diss.rml.association.type.EXPERT |
| Phenylarsine oxide | 211-275-3 | 637-03-6 | diss.rml.association.type.EXPERT_ECHA |
| Tristrontium diarsenide | 254-407-5 | 39297-24-0 | diss.rml.association.type.EXPERT_ECHA |
| Arsenic sulfide (AsS2) | - | 56320-22-0 | diss.rml.association.type.EXPERT |
| Antimony arsenic oxide | 264-904-9 | 64475-90-7 | diss.rml.association.type.EXPERT_ECHA |
| Arsenenous acid, ammonium copper salt | - | 94854-78-1 | diss.rml.association.type.EXPERT |
| Sodium hydrogen [4-[(hydroxyacetyl)amino]phenyl]arsonate | 205-415-2 | 140-45-4 | diss.rml.association.type.EXPERT |
| Arsenic tribromide | 232-057-4 | 7784-33-0 | diss.rml.association.type.EXPERT_ECHA |
| Chlorotris(triphenylarsine)rhodium | 239-051-0 | 14973-92-3 | diss.rml.association.type.EXPERT |
| Disodium 3-[(o-arsonophenyl)azo]-4,5-dihydroxynaphthalene-2,7-disulphonate | 222-600-3 | 3547-38-4 | diss.rml.association.type.EXPERT |
| Arsenic acid (H3AsO4), monopotassium salt, 1/5hydrate | - | 164170-84-7 | diss.rml.association.type.EXPERT |
| Disodium 3,6-bis[(o-arsonophenyl)azo]-4,5-dihydroxynaphthalene-2,7-disulphonate | 263-516-7 | 62337-00-2 | diss.rml.association.type.EXPERT_ECHA |
| Lithium hexafluoroarsenate | 249-963-0 | 29935-35-1 | diss.rml.association.type.EXPERT_ECHA |
| Arsenic tetrachloride fluoride | - | 87198-15-0 | diss.rml.association.type.EXPERT |
| Iododimethylarsine | 211-630-2 | 676-75-5 | diss.rml.association.type.EXPERT |
| Tribarium diarsenate | 236-762-8 | 13477-04-8 | diss.rml.association.type.EXPERT_ECHA |
| Tetraarsenic trisulfide | - | 12512-13-9 | diss.rml.association.type.EXPERT |
| Disodium 3-[[2-[(dihydroxyarsino)oxy]phenyl]azo]-4,5-dihydroxynaphthalene-2,7-disulphonate | 282-454-1 | 84215-48-5 | diss.rml.association.type.EXPERT |
| Dibismuth tris(methylarsonate) | 286-401-3 | 85237-42-9 | diss.rml.association.type.EXPERT |
| Arsenic acid, copper(2+) salt | 249-916-4 | 29871-13-4 | diss.rml.association.type.EXPERT_ECHA |
| Boron arsenide (B6As) | - | 12005-70-8 | diss.rml.association.type.EXPERT |
| Arsine oxide, dichloro(2-chlorovinyl)- | - | 333-25-5 | diss.rml.association.type.EXPERT |
| Disodium methylarsonate | 205-620-7 | 144-21-8 | diss.rml.association.type.EXPERT |
| [2-(diphenylarsino)ethyl]diphenylphosphine | 245-758-5 | 23582-06-1 | diss.rml.association.type.EXPERT |
| Manganese arsenate | - | 27526-45-0 | diss.rml.association.type.EXPERT |
| Antimony arsenate | 249-347-1 | 28980-47-4 | diss.rml.association.type.EXPERT_ECHA |
| Sodium hydrogen 4-aminophenylarsonate | 204-869-9 | 127-85-5 | diss.rml.association.type.EXPERT |
| Arsenic acid, (H3-As-O4), lead(4+) salt (4:3) | - | 53404-12-9 | diss.rml.association.type.EXPERT |
| Strychnidin-10-one, arsenite (1:1) | 309-388-9 | 100258-44-4 | diss.rml.association.type.EXPERT_ECHA |
| Diiodo(phenyl)arsine | 228-965-5 | 6380-34-3 | diss.rml.association.type.EXPERT |
| Cobalt arsenide (CoAs2) | - | 12044-42-7 | diss.rml.association.type.EXPERT |
| Arsenenous acid, lutetium(3+) salt | - | 76871-65-3 | diss.rml.association.type.EXPERT |
| 3-methyl-4-(pyrrolidin-1-yl)benzenediazonium hexafluoroarsenate | 248-532-4 | 27569-09-1 | diss.rml.association.type.EXPERT_ECHA |
| Vanadium(4+) diarsenate (1:1) | 308-917-0 | 99035-51-5 | diss.rml.association.type.EXPERT_ECHA |
| Triphenylarsine | 210-032-9 | 603-32-7 | diss.rml.association.type.EXPERT |
| Arsonic acid, methyl-, compd. with 1-octanamine (1:1) | - | 6379-37-9 | diss.rml.association.type.EXPERT |
| Arsenous acid, tricopper(1+) salt | - | 33382-64-8 | diss.rml.association.type.EXPERT |
| Tripotassium arsenate 3/2hydrate | - | 62702-52-7 | diss.rml.association.type.EXPERT |
| Diphenylarsinecarbonitrile | 245-716-6 | 23525-22-6 | diss.rml.association.type.EXPERT |
| o-phenylenediarsonic acid | 217-154-1 | 1758-48-1 | diss.rml.association.type.EXPERT |
| Arsenic acid (H3AsO4), bismuth salt (1:1) | - | 13702-38-0 | diss.rml.association.type.EXPERT |
|
Flue dust, lead-refining
By-product of refining lead ores obtained from baghouse and electro-static precipitator and as slurry from scrubbers.
|
273-809-1 | 69029-67-0 | diss.rml.association.type.EXPERT_ECHA |
| Triphenylsulphonium hexafluoroarsenate(1-) | 261-009-5 | 57900-42-2 | diss.rml.association.type.EXPERT_ECHA |
| Sodium methylarsonate | 218-495-9 | 2163-80-6 | diss.rml.association.type.EXPERT |
| Arsonic acid, methyl-, calcium salt (1:1) | - | 6423-72-9 | diss.rml.association.type.EXPERT |
| Diphenylarsine | 212-589-3 | 829-83-4 | diss.rml.association.type.EXPERT |
| Methyldiphenylarsine | 213-414-3 | 945-48-2 | diss.rml.association.type.EXPERT |
| Disodium 4-[(o-arsonophenyl)azo]-3-hydroxynaphthalene-2,7-disulphonate | 222-993-1 | 3688-92-4 | diss.rml.association.type.EXPERT_ECHA |
| (Carboxymethyl)trimethylarsonium hydroxide inner salt | 634-697-3 | 64436-13-1 | diss.rml.association.type.EXPERT |
| Acetarsol | 202-582-3 | 97-44-9 | diss.rml.association.type.EXPERT |
| Terbium arsenide | 234-479-4 | 12006-08-5 | diss.rml.association.type.EXPERT_ECHA |
|
Slimes and Sludges, copper electrolytic refining, decopperized, arsenic-rich
Product obtained by centrifuging the slime discharged at the bases of cells for decopperization of electrolytic copper solutions. Composed primarily of a copper powder rich in arsenic.
|
309-772-6 | 100995-81-1 | diss.rml.association.type.EXPERT_ECHA |
| Calcium arsenate | 231-904-5 | 7778-44-1 | diss.rml.association.type.EXPERT_ECHA |
| Hydrogen hexafluoroarsenate | 241-128-9 | 17068-85-8 | diss.rml.association.type.EXPERT_ECHA |
| Sodium hydrogen allylarsonate | 304-710-4 | 94278-22-5 | diss.rml.association.type.EXPERT |
| Tricadmium diarsenide | 234-484-1 | 12006-15-4 | diss.rml.association.type.EXPERT |
| Sodium cacodylate trihydrate | 682-793-9 | 6131-99-3 | diss.rml.association.type.EXPERT_ECHA |
| 4-acetamidophenylarsonic acid | 210-541-6 | 618-22-4 | diss.rml.association.type.EXPERT |
| Diphenoxarsin-10-yl oxide | 200-377-3 | 58-36-6 | diss.rml.association.type.EXPERT |
| Arsine, bis(2-chlorovinyl)chloro- | - | 40334-69-8 | diss.rml.association.type.EXPERT |
| Sodium p-[[4-[3-(2-arsono-4-nitrophenyl)triazen-1-yl]phenyl]azo]benzenesulphonate | 217-197-6 | 1772-02-7 | diss.rml.association.type.EXPERT |
| [No public or meaningful name is available] | - | 37337-11-4 | diss.rml.association.type.EXPERT |
| Arsenic acid (H3AsO4), magnesium salt, manganese-doped | 310-019-9 | 102110-21-4 | diss.rml.association.type.EXPERT_ECHA |
| Arsenenous acid, nickel(2+) salt | - | 33992-49-3 | diss.rml.association.type.EXPERT |
| Thallium arsenide | 234-481-5 | 12006-09-6 | diss.rml.association.type.EXPERT_ECHA |
| Trimanganese arsenide | 262-667-6 | 61219-26-9 | diss.rml.association.type.EXPERT_ECHA |
| Phenylarsonic acid | 202-631-9 | 98-05-5 | diss.rml.association.type.EXPERT |
| Arsenous acid, copper(2+) salt, hydrate, (2:3:3) | - | 73156-86-2 | diss.rml.association.type.EXPERT |
| Arsenenous acid, rubidium salt | - | 85906-44-1 | diss.rml.association.type.EXPERT |
| Arsenic acid, sodium salt | 231-547-5 | 7631-89-2 | diss.rml.association.type.EXPERT_ECHA |
| Sodium hydrogen (3-acetamido-4-hydroxyphenyl)arsonate | 227-573-1 | 5892-48-8 | diss.rml.association.type.EXPERT |
| Arsenic acid (H3AsO4), magnesium salt (2:3) | - | 21480-65-9 | diss.rml.association.type.EXPERT |
| Silicic acid (H4SiO4), tetraethyl ester, polymer with arsenic oxide (As2O3) | - | 68957-75-5 | diss.rml.association.type.EXPERT |
| Silver hexafluoroarsenate | 624-776-0 | 12005-82-2 | diss.rml.association.type.EXPERT |
| Trinickel bis(arsenate) | 236-771-7 | 13477-70-8 | diss.rml.association.type.EXPERT_ECHA |
| Copper diarsenite | 240-574-1 | 16509-22-1 | diss.rml.association.type.EXPERT_ECHA |
| Calcium bis(dimethylarsinate) | 227-311-6 | 5785-43-3 | diss.rml.association.type.EXPERT |
| 4-(diethylamino)-2-ethoxybenzenediazonium hexafluoroarsenate | 264-027-1 | 63217-33-4 | diss.rml.association.type.EXPERT_ECHA |
| Arsenic sulfide | 215-117-4 | 1303-33-9 | diss.rml.association.type.EXPERT_ECHA |
| Potassium arsonate | 233-337-9 | 10124-50-2 | diss.rml.association.type.EXPERT |
| 2,2'-[ethylenebis(oxy)]bis[1,3,2-dioxarsolane] | 238-911-2 | 14849-23-1 | diss.rml.association.type.EXPERT |
| Bis[(2-diphenylarsinoethyl)phenyl]phosphine | 245-756-4 | 23582-05-0 | diss.rml.association.type.EXPERT |
| Cobalt arsenide | 265-784-0 | 65453-05-6 | diss.rml.association.type.EXPERT_ECHA |
| Arsenic triiodide | 232-068-4 | 7784-45-4 | diss.rml.association.type.EXPERT_ECHA |
|
Flue dust, arsenic-contg.
Formed when arsenic and metal oxide particles are driven off during the roasting and converting of copper concentrates and matte in the production of anode copper.
|
232-434-3 | 8028-73-7 | diss.rml.association.type.EXPERT_ECHA |
| Difetarsone | 222-866-0 | 3639-19-8 | diss.rml.association.type.EXPERT |
| Potassium hexafluoroarsenate | 241-102-7 | 17029-22-0 | diss.rml.association.type.EXPERT_ECHA |
| Holmium arsenide | 234-476-8 | 12005-92-4 | diss.rml.association.type.EXPERT_ECHA |
| Tetraphenylarsonium chloride | 208-070-6 | 507-28-8 | diss.rml.association.type.EXPERT |
| Arsenic chloride | - | 37226-49-6 | diss.rml.association.type.EXPERT |
| Arsenic(II) sulfide | - | 12044-79-0 | diss.rml.association.type.EXPERT |
| Sodium hexafluoroarsenate(V) | 624-772-9 | 12005-86-6 | diss.rml.association.type.EXPERT_ECHA |
| Neodymium arsenide | 235-504-1 | 12255-09-3 | diss.rml.association.type.EXPERT_ECHA |
| 3-formamido-4-hydroxyphenylarsonic acid | 262-085-2 | 60154-16-7 | diss.rml.association.type.EXPERT |
| Tristrontium diarsenate | 236-684-4 | 13464-68-1 | diss.rml.association.type.EXPERT_ECHA |
| Thallium triarsenide | 281-902-3 | 84057-85-2 | diss.rml.association.type.EXPERT_ECHA |
| Arsenous acid | - | 13464-58-9 | diss.rml.association.type.EXPERT |
| Benzenesulfonic acid, 4-arsenoso- | - | 71130-51-3 | diss.rml.association.type.EXPERT |
| Dichloro(ethyl)arsine | 209-919-3 | 598-14-1 | diss.rml.association.type.EXPERT |
| Arsenic bromide | 265-296-8 | 64973-06-4 | diss.rml.association.type.EXPERT_ECHA |
| Tris(pentane-2,4-dionato-O,O')silicon hexafluoroarsenate | 266-621-6 | 67251-38-1 | diss.rml.association.type.EXPERT_ECHA |
| Zinc arsenenate oxide (Zn5(AsO3)4O3), tetrahydrate | - | 1303-39-5 | diss.rml.association.type.EXPERT |
| Potassium arsenite | 236-680-2 | 13464-35-2 | diss.rml.association.type.EXPERT_ECHA |
| Chlorodiphenylarsine | 211-921-4 | 712-48-1 | diss.rml.association.type.EXPERT |
| Aluminium gallium arsenide | 680-872-2 | 37382-15-3 | diss.rml.association.type.EXPERT |
| Arsenic acid, tripotassium salt | - | 13464-36-3 | diss.rml.association.type.EXPERT |
| Arsenenous acid, cadmium salt | - | 84953-43-5 | diss.rml.association.type.EXPERT |
| Niobium arsenide | 235-503-6 | 12255-08-2 | diss.rml.association.type.EXPERT_ECHA |
| Triethyl arsenite | 221-543-1 | 3141-12-6 | diss.rml.association.type.EXPERT_ECHA |
| Methyl 17α-hydroxyyohimban-16α-carboxylate, methylarsonate (1:1) | 279-628-4 | 80925-03-7 | diss.rml.association.type.EXPERT |
| Tris[(8α)-6'-methoxycinchonan-9(R)-ol] arsenite | 303-002-2 | 94138-87-1 | diss.rml.association.type.EXPERT_ECHA |
| Dichloro(phenyl)arsine | 211-791-9 | 696-28-6 | diss.rml.association.type.EXPERT |
| 10-chloro-5,10-dihydrophenarsazine | 209-433-1 | 578-94-9 | diss.rml.association.type.EXPERT |
| Sodium dioxoarsenate | 232-070-5 | 7784-46-5 | diss.rml.association.type.EXPERT_ECHA |
| 10-chloro-10H-phenoxarsine | 220-684-6 | 2865-70-5 | diss.rml.association.type.EXPERT |
| Tin arsenide (SnAs) | - | 12044-32-5 | diss.rml.association.type.EXPERT |
| Arsenic acid (H3AsO4), lead(4+) salt (2:1), monohydrate | - | 33940-95-3 | diss.rml.association.type.EXPERT |
| Arsenopyrite, cobaltoan | - | 12414-94-7 | diss.rml.association.type.EXPERT |
| Ytterbium arsenide | 234-483-6 | 12006-12-1 | diss.rml.association.type.EXPERT_ECHA |
| Tripotassium arsenide | 234-949-9 | 12044-21-2 | diss.rml.association.type.EXPERT_ECHA |
| Ammonium copper arsenate | 251-151-6 | 32680-29-8 | diss.rml.association.type.EXPERT_ECHA |
| Diarsenic acid, sodium salt | - | 13464-42-1 | diss.rml.association.type.EXPERT |
| Praseodymium arsenide | 234-953-0 | 12044-28-9 | diss.rml.association.type.EXPERT_ECHA |
| Disodium p-tolylarsonate | 304-956-2 | 94313-58-3 | diss.rml.association.type.EXPERT |
| Arsthinol | 204-361-7 | 119-96-0 | diss.rml.association.type.EXPERT |
| Sodium oxidoarsonous acid | - | 60189-99-3 | diss.rml.association.type.EXPERT |
| Arsenic acid (H3AsO4), lead(2+) salt (2:3), tetrahydrate | - | 120119-64-4 | diss.rml.association.type.EXPERT |
| Difetarsone disodium | 208-209-0 | 515-76-4 | diss.rml.association.type.EXPERT |
| Arsenic acid (H3AsO4), lead(2+) salt (4:5) | - | 89054-03-5 | diss.rml.association.type.EXPERT |
| Tricopper arsenide | 234-472-6 | 12005-75-3 | diss.rml.association.type.EXPERT_ECHA |
| Iron arsenide | 234-947-8 | 12044-16-5 | diss.rml.association.type.EXPERT_ECHA |
| Silicic acid (H4SiO4), zinc salt (1:2), arsenic and manganese-doped | 271-895-5 | 68611-46-1 | diss.rml.association.type.EXPERT_ECHA |
| Digallium arsenide phosphide | 234-948-3 | 12044-20-1 | diss.rml.association.type.EXPERT_ECHA |
| Neoarsphenamine | 207-273-7 | 457-60-3 | diss.rml.association.type.EXPERT_ECHA |
| Arsenous acid, gallium salt (1:1) | - | 24343-41-7 | diss.rml.association.type.EXPERT |
| Arsonic acid, methyl-, iron salt (9CI) | - | 33972-75-7 | diss.rml.association.type.EXPERT |
| Arsenic oxide | - | 12777-38-7 | diss.rml.association.type.EXPERT |
| Triantimony arsenide | 235-505-7 | 12255-36-6 | diss.rml.association.type.EXPERT_ECHA |
| Triphenylarsine oxide | 214-571-0 | 1153-05-5 | diss.rml.association.type.EXPERT |
| Sodium p-arsonobenzenesulphonate | 229-632-7 | 6634-88-4 | diss.rml.association.type.EXPERT |
| (4-aminophenyl)arsonic acid, compound with piperazine (1:1) | 303-952-8 | 94232-26-5 | diss.rml.association.type.EXPERT |
| Lanthanum arsenide | 235-502-0 | 12255-04-8 | diss.rml.association.type.EXPERT_ECHA |
| 2-aminophenylarsonic acid | 218-064-5 | 2045-00-3 | diss.rml.association.type.EXPERT |
| Diarsenic pentaoxide | 215-116-9 | 1303-28-2 | diss.rml.association.type.EXPERT_ECHA |
| 3-amino-4-hydroxyphenylarsonic acid | 218-494-3 | 2163-77-1 | diss.rml.association.type.EXPERT |
| Arsenic acid (H3AsO4), lead(4+) salt (3:2) | - | 10102-48-4 | diss.rml.association.type.EXPERT |
| Tetraphenylarsonium Chloride Hydrochloride Hydrate | 621-302-4 | 123334-18-9 | diss.rml.association.type.EXPERT |
| Arsenic trichloride | - | 60646-36-8 | diss.rml.association.type.EXPERT |
| Calcium arsenate fluoride | - | 17068-86-9 | diss.rml.association.type.EXPERT |
| Arsenenous acid, cobalt(2+) salt | - | 85561-28-0 | diss.rml.association.type.EXPERT |
| Oxophenarsine | 206-178-8 | 306-12-7 | diss.rml.association.type.EXPERT_ECHA |
| Ammonium dihydrogenarsenate | 236-667-1 | 13462-93-6 | diss.rml.association.type.EXPERT_ECHA |
| Arsenous acid, iron(3+) salt (1:1) | - | 60168-33-4 | diss.rml.association.type.EXPERT |
| trisodium;trioxido(oxo)-$l^{5}-arsane;dodecahydrate | - | 13510-46-8 | diss.rml.association.type.EXPERT |
| Trisodium arsenite | 236-681-8 | 13464-37-4 | diss.rml.association.type.EXPERT_ECHA |
| Arsenenous acid, cerium(3+) salt | - | 86859-93-0 | diss.rml.association.type.EXPERT |
| Arsenic acid (H3AsO4), cobalt(2+) salt | - | 29871-10-1 | diss.rml.association.type.EXPERT |
| Zinc arsenide | - | 56450-43-2 | diss.rml.association.type.EXPERT |
| Strychnidin-10-one, compd. with methylarsonate (1:1) | 279-614-8 | 80879-64-7 | diss.rml.association.type.EXPERT |
| Arsenic acid (H3AsO4), copper(2+) salt (1:1), sesquihydrate | - | 88442-64-2 | diss.rml.association.type.EXPERT |
| Thulium arsenide | 234-482-0 | 12006-10-9 | diss.rml.association.type.EXPERT_ECHA |
| Arsenenous acid, silver(1+) salt | - | 69507-43-3 | diss.rml.association.type.EXPERT |
| Leucomycin V, 9-O-[5-(dimethylamino)tetrahydro-6-methyl-2H-pyran-2-yl]-, [9(5S,6R)]-, [1,2-ethanediylbis(imino-4,1-phenylene)]bis[arsonate] (1:1) (salt) | 299-051-1 | 93841-79-3 | diss.rml.association.type.EXPERT |
| Tetraphenylarsonium bromide | 208-069-0 | 507-27-7 | diss.rml.association.type.EXPERT |
| Methyl 1,2,5,6-tetrahydro-1-methylnicotinate, mono[(3-acetamido-4-hydroxyphenyl)arsonate] | 212-983-5 | 900-77-6 | diss.rml.association.type.EXPERT |
| Tri-p-tolylarsine | 220-776-6 | 2896-10-8 | diss.rml.association.type.EXPERT |
| Arsenic acid (H3AsO4), calcium salt (4:5) | - | 89067-81-2 | diss.rml.association.type.EXPERT |
| Arsenic selenide | - | 12626-31-2 | diss.rml.association.type.EXPERT |
| Bis(pentane-2,4-dionato-O,O')boron(1+) hexafluoroarsenate(1-) | 272-591-5 | 68892-01-3 | diss.rml.association.type.EXPERT_ECHA |
| Disodium hydrogen 2-[[7-[(2-arsonophenyl)azo]-1,8-dihydroxy-3,6-disulphonato-2-naphthyl]azo]benzoate | 238-715-7 | 14674-83-0 | diss.rml.association.type.EXPERT |
| N-(p-arsenosophenyl)-1,3,5-triazine-2,4,6-triamine | 244-612-8 | 21840-08-4 | diss.rml.association.type.EXPERT_ECHA |
| Arsenenous acid, manganese(2+) salt | - | 85561-29-1 | diss.rml.association.type.EXPERT |
| Ferric arsenite, basic | - | 63989-69-5 | diss.rml.association.type.EXPERT |
| Arsonic acid, lead(2+) salt (1:1) | - | 109882-46-4 | diss.rml.association.type.EXPERT |
| Iron arsenate | 233-274-7 | 10102-49-5 | diss.rml.association.type.EXPERT_ECHA |
| Arsenenous acid, praseodymium(3+) salt | - | 86859-92-9 | diss.rml.association.type.EXPERT |
| Arsenic tetrasulfide | - | 56729-51-2 | diss.rml.association.type.EXPERT |
| Tricobalt diarsenate | 246-429-9 | 24719-19-5 | diss.rml.association.type.EXPERT_ECHA |
| Thiobis[methylarsine], anhydrosulphide | 236-436-5 | 13367-92-5 | diss.rml.association.type.EXPERT |
| Arsenous acid, lead(2+) salt (1:1) | - | 100822-74-0 | diss.rml.association.type.EXPERT |
| Gallium arsenic phosphide | - | 60953-19-7 | diss.rml.association.type.EXPERT |
| 2-[[7-[(2-arsonophenyl)azo]-1,8-dihydroxy-3,6-disulpho-2-naphthyl]azo]benzoic acid | 223-216-9 | 3772-44-9 | diss.rml.association.type.EXPERT |
| Tetraphenylarsonium chloride, compound with hydrochloric acid (1:1) | 277-208-5 | 73003-83-5 | diss.rml.association.type.EXPERT |
| Sulfarsphenamine | 210-564-1 | 618-82-6 | diss.rml.association.type.EXPERT_ECHA |
| Arsenenous acid, calcium salt (2:1) | - | 15194-98-6 | diss.rml.association.type.EXPERT |
| Dichromium arsenide | 235-499-6 | 12254-85-2 | diss.rml.association.type.EXPERT_ECHA |
| 4-hydroxyphenylarsonic acid | 202-641-3 | 98-14-6 | diss.rml.association.type.EXPERT |
| Diiron arsenide | 234-474-7 | 12005-88-8 | diss.rml.association.type.EXPERT_ECHA |
| 2,6-dimethyl-4-(1-naphthyl)pyrylium hexafluoroarsenate | 282-682-1 | 84282-36-0 | diss.rml.association.type.EXPERT_ECHA |
| Strychnine dimethylarsinate | 233-973-7 | 10476-87-6 | diss.rml.association.type.EXPERT |
| Trimagnesium diarsenide | 234-954-6 | 12044-49-4 | diss.rml.association.type.EXPERT_ECHA |
| Europium arsenide | 251-206-4 | 32775-46-5 | diss.rml.association.type.EXPERT_ECHA |
| Cobalt arsenide (CoAs3) | - | 12256-04-1 | diss.rml.association.type.EXPERT |
| Arsenic acid | 231-901-9 | 7778-39-4 | diss.rml.association.type.EXPERT_ECHA |
| Disodium [4-[(4,6-diamino-1,3,5-triazin-2-yl)amino]phenyl]arsonate | 222-749-4 | 3599-28-8 | diss.rml.association.type.EXPERT |
| Tryparsamide | 209-070-9 | 554-72-3 | diss.rml.association.type.EXPERT |
| Arsenic disulfide | 627-949-9 | 1303-32-8 | diss.rml.association.type.EXPERT |
| Arsine, tris(2-chloroethenyl)- | - | 40334-70-1 | diss.rml.association.type.EXPERT |
| Tritylium hexafluoroarsenate | 207-111-5 | 437-15-0 | diss.rml.association.type.EXPERT_ECHA |
| Arsenazo III sodium | 630-782-4 | 138608-19-2 | diss.rml.association.type.EXPERT |
| Arsenic sulfide (As2S4) | - | - | diss.rml.association.type.EXPERT |
| 2,6-dimethyl-4-phenylpyrylium hexafluoroarsenate | 282-700-8 | 84304-15-4 | diss.rml.association.type.EXPERT_ECHA |
| 10-[(dimethylthiocarbamoyl)thio]-5,10-dihydrophenarsazine | 225-368-1 | 4808-24-6 | diss.rml.association.type.EXPERT |
| Arsenic acid, calcium salt (1:2) | - | 13464-39-6 | diss.rml.association.type.EXPERT |
| 4-chlorophenylarsonic acid | 226-622-4 | 5440-04-0 | diss.rml.association.type.EXPERT |
| Arsenenic acid | - | 10102-53-1 | diss.rml.association.type.EXPERT |
| Arsenous acid, titanium salt | - | 92278-94-9 | diss.rml.association.type.EXPERT |
|
Slimes and Sludges, copper-lead ore roasting off gas scrubbing, arsenic-contg.
The product obtained by the purification of copper-lead ore concentrate roasting offgas. Composed primarily of arsenic oxide (As2O3).
|
310-063-9 | 102110-62-3 | diss.rml.association.type.EXPERT_ECHA |
| p-tolylarsonic acid | 223-588-2 | 3969-54-8 | diss.rml.association.type.EXPERT |
| Arsenic pentachloride | - | 22441-45-8 | diss.rml.association.type.EXPERT |
| Nitarsone | 202-695-8 | 98-72-6 | diss.rml.association.type.EXPERT |
| Copper arsonate | 233-644-8 | 10290-12-7 | diss.rml.association.type.EXPERT |
| Arsenic chloride (AsCl2) | - | 41996-37-6 | diss.rml.association.type.EXPERT |
| Rammelsbergite (NiAs2) | - | 1303-22-6 | diss.rml.association.type.EXPERT |
| Gallium arsenide phosphide | - | 106097-61-4 | diss.rml.association.type.EXPERT |
| Trimethylarsine | 209-815-8 | 593-88-4 | diss.rml.association.type.EXPERT |
| Benzenesulfonic acid, 4-arsenoso-, sodium salt | - | 71130-50-2 | diss.rml.association.type.EXPERT |
| Methylarsonic acid | 204-705-6 | 124-58-3 | diss.rml.association.type.EXPERT |
| Strychnine arsenate | 233-970-0 | 10476-82-1 | diss.rml.association.type.EXPERT_ECHA |
| Sodium metaarsenate | 239-171-3 | 15120-17-9 | diss.rml.association.type.EXPERT_ECHA |
| Mercury hydrogenarsenate | 232-062-1 | 7784-37-4 | diss.rml.association.type.EXPERT_ECHA |
| Sodium hydrogen [4-(acetamido)phenyl]arsonate | 209-558-1 | 585-54-6 | diss.rml.association.type.EXPERT |
| Triethyl arsenate | 427-700-2 | 15606-95-8 | diss.rml.association.type.EXPERT |
| Tricalcium diarsenite | 248-266-9 | 27152-57-4 | diss.rml.association.type.EXPERT_ECHA |
| Arsenic acid (H3AsO4), copper(2+) salt (4:1) | - | 102525-64-4 | diss.rml.association.type.EXPERT |
| [No public or meaningful name is available] | - | 16973-45-8 | diss.rml.association.type.EXPERT |
| Arsenenous acid, neodymium(3+) salt | - | 76871-63-1 | diss.rml.association.type.EXPERT |
| Silicic acid (H4SiO4), magnesium manganese(2+) zinc salt, arsenic and lead-doped | - | 68784-76-9 | diss.rml.association.type.EXPERT |
| Arsenenous acid, lithium salt | - | 72845-34-2 | diss.rml.association.type.EXPERT |
| 4-(2-chloroacetamido)phenylarsonic acid | 226-569-7 | 5425-62-7 | diss.rml.association.type.EXPERT |
| Roxarsone | 204-453-7 | 121-19-7 | diss.rml.association.type.EXPERT_ECHA |
| Arsine | 232-066-3 | 7784-42-1 | diss.rml.association.type.EXPERT |
| Arsine, dichloromethyl- | 695-189-5 | 593-89-5 | diss.rml.association.type.EXPERT |
| Arsenious acid (HAsO2), strontium salt | - | 15195-06-9 | diss.rml.association.type.EXPERT |
| Iron arsenide | - | 39310-41-3 | diss.rml.association.type.EXPERT |
| Sodium 4-(glycolloylamino)phenylarsonate | 231-680-9 | 7681-83-6 | diss.rml.association.type.EXPERT |
| Trisilver arsenide | 235-652-7 | 12417-99-1 | diss.rml.association.type.EXPERT_ECHA |
| Acetarsol--diethylamine (1:1) | 208-597-1 | 534-33-8 | diss.rml.association.type.EXPERT |
| Sodium arsenate dibasic heptahydrate | 677-900-0 | 10048-95-0 | diss.rml.association.type.EXPERT_ECHA |
| Arsonic acid, monoammonium salt | - | 54058-01-4 | diss.rml.association.type.EXPERT |
| [4-[(4,6-diamino-1,3,5-triazin-2-yl)amino]phenyl]arsonic acid | 227-365-0 | 5806-89-3 | diss.rml.association.type.EXPERT |
| Germanium arsenide | 235-547-6 | 12271-72-6 | diss.rml.association.type.EXPERT_ECHA |
| Calcium arsenite | 258-147-3 | 52740-16-6 | diss.rml.association.type.EXPERT |
| Zirconium arsenide | 262-524-8 | 60909-47-9 | diss.rml.association.type.EXPERT_ECHA |
| o-phenylenebis(dimethylarsine) | 236-227-9 | 13246-32-7 | diss.rml.association.type.EXPERT |
| Arsonic acid, tin salt | - | 93080-00-3 | diss.rml.association.type.EXPERT |
| Arsenenous acid, zinc salt | - | 10326-24-6 | diss.rml.association.type.EXPERT |
| Zinc arsenate, octahydrate | - | 13510-72-0 | diss.rml.association.type.EXPERT |
|
Lead alloy, base, dross
A scum formed on the surface of molten lead-base alloys. Includes those cases in which aluminum is used to remove arsenic, nickel and antimony.
|
273-700-9 | 69011-59-2 | diss.rml.association.type.EXPERT_ECHA |
| 2,7-(bis(2-arsonophenylazo))-1,8-dihydroxynaphthalene-3,6-disulphonic acid | 216-788-6 | 1668-00-4 | diss.rml.association.type.EXPERT |
| Lutetium arsenide | 234-477-3 | 12005-94-6 | diss.rml.association.type.EXPERT_ECHA |
| Carbarsone | 204-484-6 | 121-59-5 | diss.rml.association.type.EXPERT |
| Arsenenous acid | - | 13768-07-5 | diss.rml.association.type.EXPERT |
| Arsonic acid, [4-[[4-(dimethylamino)phenyl]azo]phenyl]-, monohydrochloride | 620-678-7 | 73688-85-4 | diss.rml.association.type.EXPERT |
| Tetraphenylarsonium (hydrogen dichloride) | 244-144-4 | 21006-73-5 | diss.rml.association.type.EXPERT |
| Calcium bis(methylarsonate) | 227-598-8 | 5902-95-4 | diss.rml.association.type.EXPERT |
| Strontium arsenite (Sr(As2O4)) | - | 91724-16-2 | diss.rml.association.type.EXPERT |
| Allylarsonic acid | 209-678-4 | 590-34-1 | diss.rml.association.type.EXPERT |
| Gadolinium arsenide | 234-475-2 | 12005-89-9 | diss.rml.association.type.EXPERT_ECHA |
| Manganese hydrogenarsenate | 232-063-7 | 7784-38-5 | diss.rml.association.type.EXPERT_ECHA |
| Gallium arsenide | 215-114-8 | 1303-00-0 | diss.rml.association.type.EXPERT_ECHA |
| Tricalcium diarsenide | 235-509-9 | 12255-53-7 | diss.rml.association.type.EXPERT_ECHA |
| Boron arsenide (BAs) | - | 12005-69-5 | diss.rml.association.type.EXPERT |
| Sodium dimethylarsinate | 204-708-2 | 124-65-2 | diss.rml.association.type.EXPERT_ECHA |
| Arsanilic acid | 202-674-3 | 98-50-0 | diss.rml.association.type.EXPERT |
| Trisodium 4-[(o-arsonophenyl)azo]-3-oxidonaphthalene-2,7-disulphonate | 258-693-2 | 53669-45-7 | diss.rml.association.type.EXPERT |
| Arsenic acid (H3AsO4), ammonium salt (2:1) | - | 127795-79-3 | diss.rml.association.type.EXPERT |
| 4-Aminophenylarsenoxide | - | 1122-90-3 | diss.rml.association.type.EXPERT |
| arsenic acid (H3AsO4), calcium salt(2:3), dihydrate | - | 30621-31-9 | diss.rml.association.type.EXPERT |
| Glycobiarsol | 204-143-1 | 116-49-4 | diss.rml.association.type.EXPERT |
| 4-cyclohexyl-2,6-dimethylpyrylium hexafluoroarsenate | 282-701-3 | 84304-16-5 | diss.rml.association.type.EXPERT_ECHA |
| Disodium hydrogenarsenate | 231-902-4 | 7778-43-0 | diss.rml.association.type.EXPERT_ECHA |
| Iron tris(dimethylarsinate) | 227-759-2 | 5968-84-3 | diss.rml.association.type.EXPERT |
| Arsenic acid (H3AsO4), calcium salt (7:10) | - | 85949-61-7 | diss.rml.association.type.EXPERT |
| Melarsoprol | 207-793-4 | 494-79-1 | diss.rml.association.type.EXPERT |
| Diarsenic triselenide | 215-119-5 | 1303-36-2 | diss.rml.association.type.EXPERT_ECHA |
| Arsorane, pentahydroxy-, copper(2+) salt (1:2) | - | - | diss.rml.association.type.EXPERT |
| Disilver arsenide | 274-573-2 | 70333-07-2 | diss.rml.association.type.EXPERT_ECHA |
| Trilead diarsenate | 222-979-5 | 3687-31-8 | diss.rml.association.type.EXPERT_ECHA |
| Arsenic acid (H3AsO4), dipotassium salt | - | 21093-83-4 | diss.rml.association.type.EXPERT |
| Melarsonyl potassium | 236-405-6 | 13355-00-5 | diss.rml.association.type.EXPERT |
| Methylenebis(diphenylarsine) | 244-639-5 | 21892-63-7 | diss.rml.association.type.EXPERT |
| Arsenenous acid, cesium salt | - | 82005-78-5 | diss.rml.association.type.EXPERT |
| Arsenous acid, antimony(3+) salt (1:1) | - | 12523-20-5 | diss.rml.association.type.EXPERT |
| Tin arsenide (Sn4As3) | - | 12397-66-9 | diss.rml.association.type.EXPERT |
| (diphenylarsino)dimethylgallium | 302-587-1 | 94113-53-8 | diss.rml.association.type.EXPERT |
| 4-[(2-arsonophenyl)azo]-3-hydroxynaphthalene-2,7-disulphonic acid | 205-058-2 | 132-33-2 | diss.rml.association.type.EXPERT |
EU Privacy Disclaimer
This website uses cookies to ensure you get the best experience on our websites.