Registration Dossier

Diss Factsheets

Reference substances

Reference substances

Currently viewing:
IUPAC name:
undec-10-enoic acid

Inventory

EC number:
203-965-8
EC name:
Undec-10-enoic acid
CAS number:
112-38-9
CAS number:
112-38-9
Synonyms
Names:
10-Undecenoic acid
undec-10-enoic acid

Molecular and structural information

Molecular formula:
C11H20O2
Molecular weight:
184.275
SMILES notation:
OC(=O)CCCCCCCCC=C
InChl:
InChI=1/C11H20O2/c1-2-3-4-5-6-7-8-9-10-11(12)13/h2H,1,3-10H2,(H,12,13)
Structural formula:
Chemical structure

Related substances

Categories Display