Registration Dossier

Diss Factsheets

Reference substances

Reference substances

Currently viewing:
IUPAC name:
(1R)-1-phenyl-1-(pyridin-2-yl)ethan-1-ol (1S)-1-phenyl-1-(pyridin-2-yl)ethan-1-ol dihydrochloride

Inventory

CAS number:
879671-67-7
Synonyms
Names:
2-(1-hydroxy-1-phenylethyl)pyridinium chloride

Molecular and structural information

Molecular formula:
C13H14ClNO
Molecular weight:
ca. 235.7
SMILES notation:
[Cl-].CC(O)(c1ccccc1)c2[nH+]cccc2.
Structural formula:
Chemical structure

Related substances