Registration Dossier

Diss Factsheets

Reference substances

Reference substances

Currently viewing:
IUPAC name:
dodecane-1,2-diol

Inventory

EC number:
214-289-8
EC name:
Dodecane-1,2-diol
CAS number:
1119-87-5
CAS number:
1119-87-5

Synonyms

Molecular and structural information

Molecular formula:
C12H26O2
Molecular weight:
202.334
SMILES notation:
CCCCCCCCCCC(O)CO
InChl:
InChI=1/C12H26O2/c1-2-3-4-5-6-7-8-9-10-12(14)11-13/h12-14H,2-11H2,1H3
Structural formula:
Chemical structure

Related substances