Registration Dossier

Diss Factsheets

Reference substances

Reference substances

IUPAC name:
2-bromopropionic acid

Inventory

EC number:
209-947-6
EC name:
2-bromopropionic acid
CAS number:
598-72-1
CAS number:
598-72-1
Synonyms
Names:
Propanoic acid, 2-bromo-
2-bromopropanoic acid

Molecular and structural information

Molecular formula:
C3H5BrO2
Molecular weight:
152.975
SMILES notation:
CC(Br)C(=O)O
InChl:
InChI=1/C3H5BrO2/c1-2(4)3(5)6/h2H,1H3,(H,5,6)
Structural formula:
Chemical structure

Related substances