Registration Dossier

Diss Factsheets

Reference substances

Reference substances

Currently viewing:
IUPAC name:
2-cyano-N-(2,4-dichloro-5-methoxyphenyl)acetamide

Inventory

CAS number:
846023-24-3
Synonyms
Names:
PF-05296712
WAY-186478
WAY-186478 Step 3
2-cyano-N-(2,4-dichloro-5-methoxyphenyl)acetamide

Molecular and structural information

Molecular formula:
C10H8Cl2N2O2
Molecular weight:
ca. 259.09
SMILES notation:
ClC1=C(NC(CC#N)=O)C=C(OC)C(Cl)=C1
Structural formula:
Chemical structure

Related substances