Registration Dossier

Diss Factsheets

Reference substances

Reference substances

IUPAC name:
4-nitro-o-xylene

Inventory

EC number:
202-761-6
EC name:
4-nitro-o-xylene
CAS number:
99-51-4
CAS number:
99-51-4
Synonyms
Names:
1,2-dimethyl-4-nitrobenzene
Benzene, 1,2-dimethyl-4-nitro-
1,2-dimethyl-4-nitrobenzene

Molecular and structural information

Molecular formula:
C8H9NO2
Molecular weight:
151.163
SMILES notation:
Cc1ccc(cc1C)[N+](=O)[O-]
InChl:
InChI=1/C8H9NO2/c1-6-3-4-8(9(10)11)5-7(6)2/h3-5H,1-2H3
Structural formula:
Chemical structure

Related substances