Registration Dossier

Diss Factsheets

Reference substances

Reference substances

IUPAC name:
(2R)-2-(acetyloxy)-2-phenylacetic acid

Inventory

CAS number:
51019-43-3
Synonyms
Names:
R-(-)-2-Acetoxy-phenylessigsäure
(R)-2-acetoxy-2-phenylacetic acid

Molecular and structural information

Molecular formula:
C10H10O4
Molecular weight:
194.18
SMILES notation:
OC([C@H](OC(C)=O)C1=CC=CC=C1)=O
InChl:
InChI=1S/C10H10O4/c1-7(11)14-9(10(12)13)8-5-3-2-4-6-8/h2-6,9H,1H3,(H,12,13)/t9-/m1/s1
Structural formula:
Chemical structure

Related substances