Registration Dossier

Diss Factsheets

IUPAC name:
4-amino-2-hydroxy-N,N,N-trimethyl-4-oxobutan-1-aminium chloride

Inventory

EC number:
226-073-0
EC name:
[(±)-(4-amino-2-hydroxy-4-oxobutyl)trimethylammonium] chloride
CAS number:
5261-99-4
CAS number:
5261-99-4

Synonyms

Molecular and structural information

Molecular formula:
C7H17N2O2.Cl
Molecular weight:
196.675
SMILES notation:
[Cl-].C[N+](C)(C)CC(O)CC(=O)N
InChl:
InChI=1/C7H16N2O2.ClH/c1-9(2,3)5-6(10)4-7(8)11;/h6,10H,4-5H2,1-3H3,(H-,8,11);1H
Structural formula:
Chemical structure

Related substances