Registration Dossier

Diss Factsheets

Reference substances

Reference substances

Currently viewing:
IUPAC name:
4-chlorobenzenesulphonyl chloride

Inventory

EC number:
202-685-3
EC name:
4-chlorobenzenesulphonyl chloride
CAS number:
98-60-2
CAS number:
98-60-2
Synonyms
Names:
4-chlorobenzenesulphonyl_chloride
Benzenesulfonyl chloride, 4-chloro-
Identifier:
PubChem
4-chlorobenzene-1-sulfonyl chloride
Identifier:
PubChem
Benzenesulfonyl chloride, 4-chloro-
Identifier:
PubChem
P-Chlorobenzenesulfonyl chloride
Identifier:
PubChem
P-Chlorophenylsulfonyl chloride
Identifier:
other: SMILES notation
C1=CC(=CC=C1S(=O)(=O)Cl)Cl
Identifier:
other: InChl
InChI=1S/C6H4Cl2O2S/c7-5-1-3-6(4-2-5)11(8,9)10/h1-4H
Identifier:
other: SMILES notation
O=S(Cl)(=O)c1ccc(Cl)cc1
4-chlorobenzenesulfonyl chloride

Molecular and structural information

Molecular formula:
C6H4Cl2O2S
Molecular weight:
211.066
SMILES notation:
Clc1ccc(cc1)S(=O)(=O)Cl
InChl:
InChI=1/C6H4Cl2O2S/c7-5-1-3-6(4-2-5)11(8,9)10/h1-4H
Structural formula:
Chemical structure

Related substances