Registration Dossier

Diss Factsheets

Reference substances

Reference substances

Currently viewing:
IUPAC name:
5-chlorovaleryl chloride

Inventory

EC number:
216-403-1
EC name:
5-chlorovaleryl chloride
CAS number:
1575-61-7
CAS number:
1575-61-7
Synonyms
Names:
5-chlorovaleryl_chloride
Identifier:
other:
5-CVC
5-chloropentanoyl chloride

Molecular and structural information

Molecular formula:
C5H8Cl2O
Molecular weight:
155.022
SMILES notation:
ClCCCCC(=O)Cl
InChl:
InChI=1/C5H8Cl2O/c6-4-2-1-3-5(7)8/h1-4H2
Structural formula:
Chemical structure

Related substances