Registration Dossier

Diss Factsheets

Reference substances

Reference substances

IUPAC name:
3-chloro-N,N-dimethylpropan-1-aminium chloride

Inventory

EC number:
226-467-2
EC name:
3-chloropropyldimethylammonium chloride
CAS number:
5407-04-5
CAS number:
5407-04-5
Synonyms
Names:
1-Propanamine, 3-chloro-N,N-dimethyl-, hydrochloride
3-chloro-N,N-dimethylpropan-1-aminium chloride

Molecular and structural information

Molecular formula:
C5H12ClN.ClH
Molecular weight:
158.069
SMILES notation:
[Cl-].C[NH+](C)CCCCl
InChl:
InChI=1/C5H12ClN.ClH/c1-7(2)5-3-4-6;/h3-5H2,1-2H3;1H
Structural formula:
Chemical structure

Related substances

Categories Display