Registration Dossier

Diss Factsheets

Reference substances

Reference substances

IUPAC name:
2-(2-formyl-4-nitrophenoxy)hexanoic acid

Inventory

CAS number:
335153-21-4
Synonyms
Names:
2-(2-Formyl-4-nitrophenoxy)hexanoic acid

Molecular and structural information

Molecular formula:
C13H15NO6
Molecular weight:
281.27
SMILES notation:
O=C(O)C(CCCC)Oc1ccc(cc1C=O)[N+]([O-])=O
Structural formula:
Chemical structure

Related substances