Registration Dossier

Diss Factsheets

Reference substances

Reference substances

IUPAC name:
2,4-dihydro-5-methyl-2-phenyl-3H-pyrazol-3-imine

Inventory

EC number:
229-014-7
EC name:
2,4-dihydro-5-methyl-2-phenyl-3H-pyrazol-3-imine
CAS number:
6401-97-4
CAS number:
6401-97-4
Synonyms
Names:
2,4-dihydro-5-methyl-2-phenyl-3H-pyrazol-3-imine

Molecular and structural information

Molecular formula:
C10H11N3
Molecular weight:
ca. 173
SMILES notation:
N=C1N(C2=CC=CC=C2)N=C(C)C1
InChl:
1S/C10H11N3/c1-8-7-10(11)13(12-8)9-5-3-2-4-6-9/h2-6,11H,7H2,1H3
Structural formula:
Chemical structure

Related substances