Registration Dossier

Reference substances

Reference substances

IUPAC name:
2,3-dichloroprop-1-ene

Inventory

EC number:
201-153-8
EC name:
2,3-dichloropropene
CAS number:
78-88-6
CAS number:
78-88-6
Synonyms
Names:
1-Propene, 2,3-dichloro-
2,3-dichloroprop-1-ene

Molecular and structural information

Molecular formula:
C3H4Cl2
Molecular weight:
110.97
SMILES notation:
ClCC(=C)Cl
InChl:
InChI=1/C3H4Cl2/c1-3(5)2-4/h1-2H2
Structural formula:
Chemical structure

Related substances