Registration Dossier

Diss Factsheets

Reference substances

Reference substances

IUPAC name:
4-aminobenzene-1,3-disulphonic acid

Inventory

EC number:
205-299-3
EC name:
4-aminobenzene-1,3-disulphonic acid
CAS number:
137-51-9
CAS number:
137-51-9
Synonyms
Names:
1,3-Benzenedisulfonic acid, 4-amino-
4-aminobenzene-1,3-disulfonic acid

Molecular and structural information

Molecular formula:
C6H7NO6S2
Molecular weight:
253.253
SMILES notation:
Nc1ccc(cc1S(=O)(=O)O)S(=O)(=O)O
InChl:
InChI=1/C6H7NO6S2/c7-5-2-1-4(14(8,9)10)3-6(5)15(11,12)13/h1-3H,7H2,(H,8,9,10)(H,11,12,13)
Structural formula:
Chemical structure

Related substances