Registration Dossier

Diss Factsheets

Reference substances

Reference substances

IUPAC name:
3-cyclohexylpropanoic acid

Inventory

EC number:
211-861-9
EC name:
3-cyclohexylpropionic acid
CAS number:
701-97-3
CAS number:
701-97-3
Synonyms
Names:
Cyclohexanepropanoic acid

Molecular and structural information

Molecular formula:
C9H16O2
Molecular weight:
156.222
SMILES notation:
OC(=O)CCC1CCCCC1
InChl:
InChI=1/C9H16O2/c10-9(11)7-6-8-4-2-1-3-5-8/h8H,1-7H2,(H,10,11)
Structural formula:
Chemical structure

Related substances

Categories Display