Registration Dossier

Diss Factsheets

Reference substances

Reference substances

Currently viewing:
IUPAC name:
isobutyryl chloride

Inventory

EC number:
201-194-1
EC name:
Isobutyryl chloride
CAS number:
79-30-1
CAS number:
79-30-1
Synonyms
Names:
2-Methylpropionyl chloride
2-methylpropanoyl chloride
Chloroisopropyl ketone
Isobutyryl chloride
Propanoyl chloride, 2-methyl-
isobutyryl chloride
Identifier:
IUPAC name
Isobutyryl chloride
2-methylpropanoyl chloride

Molecular and structural information

Molecular formula:
C4H7ClO
Molecular weight:
106.551
SMILES notation:
CC(C)C(=O)Cl
InChl:
InChI=1/C4H7ClO/c1-3(2)4(5)6/h3H,1-2H3
Structural formula:
Chemical structure

Related substances

Identifier:
CAS number
Identity:
79-30-1