Registration Dossier

Diss Factsheets

Reference substances

Reference substances

Currently viewing:
IUPAC name:
tetradecanoyl chloride

Inventory

EC number:
203-994-6
EC name:
Myristoyl chloride
CAS number:
112-64-1
CAS number:
112-64-1
Synonyms
Names:
Myristoyl chloride
Tetradecanoyl chloride
Identifier:
IUPAC name
Tetradecanoyl chloride
Identifier:
other: SMILES notation
ClC(CCCCCCCCCCCCC)=O
Identifier:
other: InChl
InChI=1S/C14H27ClO/c1-2-3-4-5-6-7-8-9-10-11-12-13-14(15)16/h2-13H2,1H3
Identifier:
other: SMILES notation
O=C(CCCCCCCCCCCCC)Cl

Molecular and structural information

Molecular formula:
C14H27ClO
Molecular weight:
246.817
SMILES notation:
CCCCCCCCCCCCCC(=O)Cl
InChl:
InChI=1/C14H27ClO/c1-2-3-4-5-6-7-8-9-10-11-12-13-14(15)16/h2-13H2,1H3
Structural formula:
Chemical structure

Related substances