Registration Dossier

Diss Factsheets

Reference substances

Reference substances

Currently viewing:
IUPAC name:
octadecanoyl chloride

Inventory

EC number:
204-004-5
EC name:
Stearoyl chloride
CAS number:
112-76-5
CAS number:
112-76-5
Synonyms
Names:
Octadecanoyl chloride
Identifier:
IUPAC name
Octadecanoyl chloride
Identifier:
other: SMILES notation
C(CCCCCCCCCCC)CCCCCC(=O)Cl
Identifier:
other: InChl
InChI=1S/C18H35ClO/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18(19)20/h2-17H2,1H3

Molecular and structural information

Molecular formula:
C18H35ClO
Molecular weight:
302.923
SMILES notation:
CCCCCCCCCCCCCCCCCC(=O)Cl
InChl:
InChI=1/C18H35ClO/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18(19)20/h2-17H2,1H3
Structural formula:
Chemical structure

Related substances