Registration Dossier

Diss Factsheets

Reference substances

Reference substances

Currently viewing:
IUPAC name:
dodecanoyl chloride

Inventory

EC number:
203-941-7
EC name:
Lauroyl chloride
CAS number:
112-16-3
CAS number:
112-16-3
Synonyms
Names:
Dodecanoyl chloride
Identifier:
IUPAC name
Dodecanoyl chloride
Identifier:
other: SMILES notation
C(CCCCCCCC)CCC(=O)Cl
Identifier:
other: SMILES notation
ClC(CCCCCCCCCCC)=O
Identifier:
other: InChl
InChI=1S/C12H23ClO/c1-2-3-4-5-6-7-8-9-10-11-12(13)14/h2-11H2,1H3

Molecular and structural information

Molecular formula:
C12H23ClO
Molecular weight:
218.763
SMILES notation:
CCCCCCCCCCCC(=O)Cl
InChl:
InChI=1/C12H23ClO/c1-2-3-4-5-6-7-8-9-10-11-12(13)14/h2-11H2,1H3
Structural formula:
Chemical structure

Related substances