Registration Dossier

Diss Factsheets

Reference substances

Reference substances

Currently viewing:
IUPAC name:
1. 3-(24-isocyanato-7,16-bis((6-isocyanatohexyl)carbamoyl)-8,17-dioxo-7,9,16,18-tetraazatetracosyl)-1-(6-isocyanatohexyl)-1-((6-isocyanatohexyl)carbamoyl)urea

Inventory

Synonyms
Names:
HDI tris biuret

Molecular and structural information

Molecular formula:
C53H90N14O11
Molecular weight:
ca. 1 099.37
SMILES notation:
O=C(N(C(N(CCCCCCN=C=O)[H])=O)CCCCCCN=C=O)NCCCCCCN(C(N(CCCCCCN=C=O)[H])=O)C(NCCCCCCN(C(N(CCCCCCN=C=O)[H])=O)C(NCCCCCCN=C=O)=O)=O
InChl:
InChI=1S/C53H90N14O11/c68-43-54-29-15-1-5-20-34-59-48(73)65(40-26-12-9-19-33-58-47-72)52(77)63-38-24-11-14-28-42-67(51(76)62-37-23-8-4-18-32-57-46-71)53(78)64-39-25-10-13-27-41-66(49(74)60-35-21-6-2-16-30-55-44-69)50(75)61-36-22-7-3-17-31-56-45-70/h1-42H2,(H,59,73)(H,60,74)(H,61,75)(H,62,76)(H,63,77)(H,64,78)
Structural formula:
Chemical structure

Related substances