Registration Dossier

Diss Factsheets

Reference substances

Reference substances

IUPAC name:
2-methylidenebutanedioic acid

Inventory

EC number:
202-599-6
EC name:
Itaconic acid
CAS number:
97-65-4
CAS number:
97-65-4
Synonyms
Names:
Butanedioic acid, methylene-
Identifier:
IUPAC name
2-methylidenebutanedioic acid
2-methylenesuccinic acid

Molecular and structural information

Molecular formula:
C5H6O4
Molecular weight:
ca. 130.099
SMILES notation:
OC(=O)CC(=C)C(=O)O
InChl:
InChI=1/C5H6O4/c1-3(5(8)9)2-4(6)7/h1-2H2,(H,6,7)(H,8,9)
Structural formula:
Chemical structure

Related substances