Registration Dossier

Diss Factsheets

Reference substances

Reference substances

Currently viewing:
IUPAC name:
valeric acid

Inventory

EC number:
203-677-2
EC name:
Valeric acid
CAS number:
109-52-4
CAS number:
109-52-4
Synonyms
Names:
Pentanoic acid
Identifier:
IUPAC name
pentanoic acid

Molecular and structural information

Molecular formula:
C5H10O2
Molecular weight:
102.132
SMILES notation:
CCCCC(=O)O
InChl:
InChI=1/C5H10O2/c1-2-3-4-5(6)7/h2-4H2,1H3,(H,6,7)
Structural formula:
Chemical structure

Related substances