Registration Dossier

Diss Factsheets

Reference substances

Reference substances

Currently viewing:
IUPAC name:
barium dioctadeca-9,12-dienoate

Inventory

EC number:
246-509-3
EC name:
Barium dilinoleate
CAS number:
24871-38-3
CAS number:
24871-38-3
Synonyms
Names:
9,12-Octadecadienoic acid (9Z,12Z)-, barium salt
9,12-Octadecadienoic acid (Z,Z)-, barium salt

Molecular and structural information

Molecular formula:
C18H32O2.1/2Ba
Molecular weight:
696.202
SMILES notation:
[Ba+2].CCCCC\C=C/C\C=C/CCCCCCCC(=O)[O-].CCCCC\C=C/C\C=C/CCCCCCCC(=O)[O-]
InChl:
InChI=1/2C18H32O2.Ba/c2*1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18(19)20;/h2*6-7,9-10H,2-5,8,11-17H2,1H3,(H,19,20);/q;;+2/p-2
Structural formula:
Chemical structure

Related substances