Registration Dossier

Reference substances

Reference substances

Currently viewing:
IUPAC name:
dioctyl but-2-enedioate

Inventory

EC number:
220-835-6
EC name:
Dioctyl maleate
CAS number:
2915-53-9
CAS number:
2915-53-9
Synonyms
Names:
2-Butenedioic acid (2Z)-, dioctyl ester
2-Butenedioic acid (Z)-, dioctyl ester

Molecular and structural information

Molecular formula:
C20H36O4
Molecular weight:
340.497
SMILES notation:
CCCCCCCCOC(=O)\C=C/C(=O)OCCCCCCCC
InChl:
InChI=1/C20H36O4/c1-3-5-7-9-11-13-17-23-19(21)15-16-20(22)24-18-14-12-10-8-6-4-2/h15-16H,3-14,17-18H2,1-2H3
Structural formula:
Chemical structure

Related substances