Registration Dossier

Diss Factsheets

Reference substances

Reference substances

IUPAC name:
thiophene-2-carbonyl chloride

Inventory

EC number:
226-092-4
EC name:
2-thienylcarbonyl chloride
CAS number:
5271-67-0
CAS number:
5271-67-0
Synonyms
Names:
2-Thiophenecarbonyl chloride
2-thienylcarbonyl_chloride

Molecular and structural information

Molecular formula:
C5H3ClOS
Molecular weight:
146.595
SMILES notation:
ClC(=O)c1cccs1
InChl:
InChI=1/C5H3ClOS/c6-5(7)4-2-1-3-8-4/h1-3H
Structural formula:
Chemical structure

Related substances