Registration Dossier

Diss Factsheets

Reference substances

Reference substances

Currently viewing:
IUPAC name:
disodium tetradec-3-ene-1,2-disulfonate\disodium hexadec-3-ene-1,2-disulfonate\disodium hydroxytetradecanedisulfonate\disodium hydroxyhexadecanedisulfonate

Inventory

Synonyms

Molecular and structural information

Molecular formula:
C14H26O6S2.2Na\C16H30O6S2.2Na\C(4+2n)H(8+4n)O7S2Na2 n = 5\C(4+2n)H(8+4n)O7S2Na2 n = 6
Molecular weight:
>= 400.462 - <= 446
Structural formula:
Chemical structure

Related substances