Registration Dossier

Diss Factsheets

Reference substances

Reference substances

Currently viewing:
IUPAC name:
(1-hydroxyethane-1,1-diyl)bis(phosphonic acid)

Inventory

EC number:
220-552-8
EC name:
Etidronic acid
CAS number:
2809-21-4
CAS number:
2809-21-4
Synonyms
Names:
(1-Hydroxyethylidene)-1,1-bis(phosphonic acid)
(1-Hydroxyethylidene)-1,1-diphosphonic acid
(1-Hydroxyethylidene)bisphosphonic acid
(1-Hydroxyethylidene)diphosphonic acid
1-Hydroxy-1,1-diphosphonoethane
1-Hydroxy-1,1-diphosphonoethane
1-Hydroxyethane-1,1-bisphosphonic acid
1-Hydroxyethane-1,1-diphosphonic acid
1-Hydroxyethane-1,1-diphosphonic acid
1-Hydroxyethane-1,1-diyldiphosphonic acid
1-Hydroxyethanediphosphonic acid
1-Hydroxyethylidene-1,1'-diphosphonic acid
1-Hydroxyethylidene-1,1-diphoshonic acid
1-Hydroxyethylidene-1,1-diphosphonic acid
1-Hydroxyethylidene-1,1-diphosphonic acid
1-Hydroxyethylidene-1,1-diphosphoric acid
1-Hydroxyethylidene-1,1-disphosphonic acid
Acetodiphosphonic acid
Acidum etidronicum
Ethane-1-hydroxy-1,1'diphosphonic acid
Ethane-1-hydroxy-1,1-diphosphonic acid
Etidronic acid
Hydroxyethanediphosphonic acid
Oxyethylidenediphosphonic acid
Phosphonic acid, (1-hydroxyethylidene)bis
Phosphonic acid, (1-hydroxyethylidene)bis-
Phosphonic acid, (1-hydroxyethylidene)bis-
Phosphonic acid, (1-hydroxyethylidene)di-
Phosphonic acid, P,P'-(1-hydroxyethylidene)bis-
Identifier:
EC name
(1-hydroxyethylidene)bisphosphonic acid
Identifier:
EC name
Etidronic acid
Identifier:
IUPAC name
(1 Hydroxy-1phosphonoethyl)-phosphonic acid
Identifier:
IUPAC name
(1-hydroxy-1-phosphonoethyl)phosphonic acid
Identifier:
IUPAC name
(1-hydroxyethane-1,1-diyl)bis(phosphonic acid)
Identifier:
IUPAC name
(1-hydroxyethylidene)bisphosphonic acid
Identifier:
common name
HEDP-H
Identifier:
common name
HEDP-H (dry form)
Identifier:
other: SMILES notation
CC(O)(P(=O)(O)O)P(=O)(O)O
Identifier:
other: InChl
InChI=1S/C2H8O7P2/c1-2(3,10(4,5)6)11(7,8)9/h3H,1H3,(H2,4,5,6)(H2,7,8,9)
Identifier:
other: SMILES notation
O=P(O)(O)C(O)(P(=O)(O)O)C
(1-hydroxyethylidene)bisphosphonic acid

Molecular and structural information

Molecular formula:
C2H8O7P2
Molecular weight:
ca. 206.03
SMILES notation:
C(P(=O)(O)O)(P(=O)(O)O)(O)C
InChl:
InChI=1/C2H8O7P2/c1-2(3,10(4,5)6)11(7,8)9/h3H,1H3,(H2,4,5,6)(H2,7,8,9)
Structural formula:
Chemical structure

Related substances

Categories Display