Registration Dossier

Diss Factsheets

Reference substances

Reference substances

IUPAC name:
N-acetylglutamic acid

Inventory

EC number:
214-708-4
EC name:
N-acetylglutamic acid
CAS number:
1188-37-0
CAS number:
1188-37-0
Synonyms
Names:
L-Glutamic acid, N-acetyl-
N-acetylglutamic acid

Molecular and structural information

Molecular formula:
C7H11NO5
Molecular weight:
189.166
SMILES notation:
CC(=O)NC(CCC(=O)O)C(=O)O
InChl:
InChI=1/C7H11NO5/c1-4(9)8-5(7(12)13)2-3-6(10)11/h5H,2-3H2,1H3,(H,8,9)(H,10,11)(H,12,13)
Structural formula:
Chemical structure

Related substances