Registration Dossier

Diss Factsheets

Reference substances

Reference substances

Currently viewing:
IUPAC name:
2,3,4,5-tetrachlorobenzoyl chloride

Inventory

CAS number:
42221-52-3
Synonyms
Names:
406-760-3
Identifier:
IUPAC name
2,3,4,5-Tetrachlorobenzoyl chloride
Identifier:
other: Molecular formula
C7HCl5O
Identifier:
other: SMILES notation
c1c(c(c(c(c1Cl)Cl)Cl)Cl)C(=O)Cl
2,3,4,5-tetrachlorobenzoyl chloride

Molecular and structural information

Molecular formula:
C7 H Cl5 O
Molecular weight:
278.35
SMILES notation:
C1(C(=O)Cl)=C(Cl)C(Cl)=C(Cl)C(Cl)=C1
Structural formula:
Chemical structure

Related substances