Registration Dossier

Diss Factsheets

Reference substances

Reference substances

IUPAC name:
2-phenylbutyryl chloride

Inventory

EC number:
253-241-0
EC name:
2-phenylbutyryl chloride
CAS number:
36854-57-6
CAS number:
36854-57-6
Synonyms
Names:
2-phenylbutyryl_chloride
Identifier:
IUPAC name
2-phenylbutanoyl chloride
2-phenylbutyryl chloride

Molecular and structural information

Molecular formula:
C10H11ClO
Molecular weight:
182.45
SMILES notation:
CCC(C(=O)Cl)c1ccccc1
InChl:
InChI=1/C10H11ClO/c1-2-9(10(11)12)8-6-4-3-5-7-8/h3-7,9H,2H2,1H3
Structural formula:
Chemical structure

Related substances

Categories Display