Registration Dossier

Reference substances

Reference substances

IUPAC name:
4-(4-methoxyphenyl)butan-2-one

Inventory

EC number:
203-184-2
EC name:
4-(4-methoxyphenyl)butan-2-one
CAS number:
104-20-1
CAS number:
104-20-1
Synonyms
Names:
2-Butanone, 4-(4-methoxyphenyl)-
4-(4-methoxyphenyl)butan-2-one

Molecular and structural information

Molecular formula:
C11H14O2
Molecular weight:
178.228
SMILES notation:
COc1ccc(CCC(=O)C)cc1
InChl:
InChI=1/C11H14O2/c1-9(12)3-4-10-5-7-11(13-2)8-6-10/h5-8H,3-4H2,1-2H3
Structural formula:
Chemical structure

Related substances