Registration Dossier

IUPAC name:
1,2,4,9-Tetrahydrocarbazol-3-one

Inventory

CAS number:
51145-61-0

Synonyms

Molecular and structural information

Molecular formula:
C12H11NO
Molecular weight:
185.2
SMILES notation:
C3C=C2C(=CC=3)NC1=C2CC(=O)CC1
Structural formula:
Chemical structure

Related substances