Registration Dossier

Diss Factsheets

Reference substances

Reference substances

IUPAC name:
(2R)-6-fluorochromane-2-carboxylic acid

Inventory

CAS number:
129101-37-7
Synonyms
Names:
(2R)-6-fluorochromane-2-carboxylic acid

Molecular and structural information

Molecular formula:
C10H9FO3
Molecular weight:
ca. 196.18
SMILES notation:
c1cc2c(cc1F)CC[C@@H](O2)C(=O)O
Structural formula:
Chemical structure

Related substances