Registration Dossier

IUPAC name:
(8R,9S,10R,13S,14S,17R)-17-ethynyl-10,13-dimethyl-1,2,4,7,8,9,10,11,12,13,14,15,16,17,-tetradecahydrospiro[cyclopenta[a]phenanthrene-3,2´-[1,3]dioxolan]-17-ol

Inventory

CAS number:
50407-76-6

Synonyms

Molecular and structural information

Molecular formula:
C23H32O3
Molecular weight:
356
SMILES notation:
C#C[C@]5(O)CC[C@@H]3[C@]5(C)CC[C@@H]2[C@@]4(C)CCC1(OCCO1)CC4=CC[C@H]23
Structural formula:
Chemical structure

Related substances