Registration Dossier

Diss Factsheets

Reference substances

Reference substances

IUPAC name:
4-[2-(piperidin-1-yl)ethoxy]benzoic acid hydrochloride

Inventory

EC number:
282-882-9
EC name:
4-[2-piperidinoethoxy]benzoic acid hydrochloride
CAS number:
84449-80-9
CAS number:
84449-80-9
Synonyms
Names:
Identifier:
IUPAC name
4-[2-Piperidinoethoxy]benzoic acid hydrochloride
4-(2-piperidin-1-ylethoxy)benzoic acid hydrochloride

Molecular and structural information

Molecular formula:
C14H19NO3.ClH
Molecular weight:
285.767
SMILES notation:
Cl.OC(=O)c1ccc(OCCN2CCCCC2)cc1
InChl:
InChI=1/C14H19NO3.ClH/c16-14(17)12-4-6-13(7-5-12)18-11-10-15-8-2-1-3-9-15;/h4-7H,1-3,8-11H2,(H,16,17);1H
Structural formula:
Chemical structure

Related substances