Registration Dossier

Diss Factsheets

Reference substances

Reference substances

Currently viewing:
IUPAC name:
hydrogen bis[4-[4,5-dihydro-4-[(2-hydroxy-5-nitrophenyl)azo]-3-methyl-5-oxo-1H-pyrazol-1-yl]benzene-1-sulphonato(3-)]ferrate(3-)

Inventory

Synonyms

Molecular and structural information

Molecular formula:
C32H23FeN10O14S2
Molecular weight:
ca. 891.56
SMILES notation:
[H+].O=S(=O)(O)c1ccc(cc1)n3nc(C)c2N=Nc8cc(ccc8O[Fe-]5(Oc23)Oc7ccc(cc7N=Nc6c(C)nn(c4ccc(cc4)S(=O)(=O)O)c6O5)[N+]([O-])=O)[N+]([O-])=O
InChl:
InChI=1S/2C16H13N5O7S.Fe/c2*1-9-15(18-17-13-8-11(21(24)25)4-7-14(13)22)16(23)20(19-9)10-2-5-12(6-3-10)29(26,27)28;/h2*2-8,22-23H,1H3,(H,26,27,28);/q;;+3/p-3/b2*18-17-;
Structural formula:
Chemical structure

Related substances