Registration Dossier

Diss Factsheets

Reference substances

Reference substances

IUPAC name:
3,4-dimethoxyphenylacetic acid

Inventory

EC number:
202-244-5
EC name:
3,4-dimethoxyphenylacetic acid
CAS number:
93-40-3
CAS number:
93-40-3
Synonyms
Names:
3,4-dimethoxyphenylacetic_acid
Benzeneacetic acid, 3,4-dimethoxy-
Identifier:
IUPAC name
(3,4-Dimethoxyphenyl)acetic acid
(3,4-dimethoxyphenyl)acetic acid

Molecular and structural information

Molecular formula:
C10H12O4
Molecular weight:
196.2
SMILES notation:
COc1ccc(CC(=O)O)cc1OC
InChl:
InChI=1/C10H12O4/c1-13-8-4-3-7(6-10(11)12)5-9(8)14-2/h3-5H,6H2,1-2H3,(H,11,12)
Structural formula:
Chemical structure

Related substances