Registration Dossier

Diss Factsheets

Reference substances

Reference substances

Currently viewing:
IUPAC name:
1,3-dichloro-2-nitrobenzene

Inventory

EC number:
210-009-3
EC name:
1,3-dichloro-2-nitrobenzene
CAS number:
601-88-7
CAS number:
601-88-7
Synonyms
Names:
1,3-dichloro-2-nitrobenzene
2,6-Dichloro-1-nitrobenzene
1,3-dichloro-2-nitrobenzene

Molecular and structural information

Molecular formula:
C6H3Cl2NO2
Molecular weight:
192
SMILES notation:
[O-][N+](=O)c1c(Cl)cccc1Cl
InChl:
InChI=1/C6H3Cl2NO2/c7-4-2-1-3-5(8)6(4)9(10)11/h1-3H
Structural formula:
Chemical structure

Related substances