Registration Dossier

Diss Factsheets

Reference substances

Reference substances

Currently viewing:
IUPAC name:
2,4-dichloro-1-nitrobenzene

Inventory

EC number:
210-248-3
EC name:
1,3-dichloro-4-nitrobenzene
CAS number:
611-06-3
CAS number:
611-06-3
Synonyms
Names:
1,3-dichloro-4-nitrobenzene
Benzene, 2,4-dichloro-1-nitro-

Molecular and structural information

Molecular formula:
C6H3Cl2NO2
Molecular weight:
192
SMILES notation:
[O-][N+](=O)c1ccc(Cl)cc1Cl
InChl:
InChI=1/C6H3Cl2NO2/c7-4-1-2-6(9(10)11)5(8)3-4/h1-3H
Structural formula:
Chemical structure

Related substances