Registration Dossier

Diss Factsheets

IUPAC name:
2-thiophen-2-ylpropanoic acid

Inventory

CAS number:
54955-39-4

Synonyms

Molecular and structural information

Molecular formula:
C7H8O2S
Molecular weight:
156.2
SMILES notation:
CC(C1=CC=CS1)C(=O)O
InChl:
InChI=1/C7H8O2S/c1-5(7(8)9)6-3-2-4-10-6/h2-5H,1H3,(H,8,9)/f/h8H
Structural formula:
Chemical structure

Related substances