Registration Dossier

Diss Factsheets

IUPAC name:
sodium 2-oxo-1,2,3,4-tetrahydroquinolin-6-olate

Inventory

CAS number:
87032-92-6

Synonyms

Molecular and structural information

Molecular formula:
C9H8NNaO2
Molecular weight:
185.155
SMILES notation:
[Na]Oc1ccc2NC(=O)CCc2c1
InChl:
InChI=1S/C9H9NO2.Na/c11-7-2-3-8-6(5-7)1-4-9(12)10-8;/h2-3,5,11H,1,4H2,(H,10,12);/q;+1/p-1
Structural formula:
Chemical structure

Related substances

Categories Display