Registration Dossier

Diss Factsheets

Reference substances

Reference substances

IUPAC name:
3,4-diethoxyphenethylamine

Inventory

EC number:
262-752-8
EC name:
3,4-diethoxyphenethylamine
CAS number:
61381-04-2
CAS number:
61381-04-2
Synonyms
Names:
α-amino-β-(3,4-diethoxyphenyl)-ethane
2-(3,4-diethoxyphenyl)ethanamine

Molecular and structural information

Molecular formula:
C12H19NO2
Molecular weight:
209.285
SMILES notation:
CCOc1ccc(CCN)cc1OCC
InChl:
InChI=1/C12H19NO2/c1-3-14-11-6-5-10(7-8-13)9-12(11)15-4-2/h5-6,9H,3-4,7-8,13H2,1-2H3
Structural formula:
Chemical structure

Related substances