Registration Dossier

Reference substances

Reference substances

IUPAC name:
(-)-3R,4R-1-Benzyl-4-(4-fluorophenyl)-3-hydroxymethyl-piperide-L-dibenzoyl tartrate

Inventory

CAS number:
201855-65-4
Synonyms
Names:
Identifier:
common name
cis-HPD-tartarate

Molecular and structural information

Molecular formula:
C19H22FNO + C18H14O8 = C37H36FNO9
Molecular weight:
657.66
SMILES notation:
OC[C@H]2C[NH+](CC[C@H]2c1ccc(F)cc1)Cc3ccccc3.O=C(O)[C@H](OC(=O)c1ccccc1)[C@@H](OC(=O)c2ccccc2)C([O-])=O
Structural formula:
Chemical structure

Related substances