Registration Dossier

Reference substances

Reference substances

Currently viewing:
IUPAC name:
2-methylbenzene-1,4-diyl bis{4-[4-(acryloyloxy)butoxy]benzoate}

Inventory

CAS number:
132900-75-5
Synonyms
Names:
Me-3K4A2
NAP-1
2-methylbenzene-1,4-diyl bis{4-[4-(acryloyloxy)butoxy]benzoate}

Molecular and structural information

Molecular formula:
C35H36O10
Molecular weight:
616.7
SMILES notation:
O=C(Oc1ccc(cc1C)OC(=O)c2ccc(OCCCCOC(=O)C=C)cc2)c3ccc(OCCCCOC(=O)C=C)cc3
Structural formula:
Chemical structure

Related substances