Registration Dossier

Diss Factsheets

Reference substances

Reference substances

IUPAC name:
2,3-dibromobutanedioic acid

Inventory

EC number:
208-396-9
EC name:
2,3-dibromosuccinic acid
CAS number:
526-78-3
CAS number:
526-78-3
Synonyms
Names:
2,3-dibromosuccinic acid

Molecular and structural information

Molecular formula:
C4H4Br2O4
Molecular weight:
275.88
SMILES notation:
OC(=O)C(Br)C(Br)C(=O)O
InChl:
InChI=1/C4H4Br2O4/c5-1(3(7)8)2(6)4(9)10/h1-2H,(H,7,8)(H,9,10)
Structural formula:
Chemical structure

Related substances