Registration Dossier

Reference substances

Reference substances

Currently viewing:
IUPAC name:


CAS number:
common name

Molecular and structural information

Molecular formula:
C36H42O12(OH)18-y((C3H6O)nOH); y = 1-10, im Mittel 3,7; n = 1-4
Molecular weight:
ca. 1 180
Structural formula:
Chemical structure

Related substances