Registration Dossier

Diss Factsheets

Reference substances

Reference substances

IUPAC name:
2-(trifluoromethyl)benzenesulfonyl chloride

Inventory

CAS number:
776-04-5
Synonyms
Names:
2-(trifluoromethyl)benzenesulfonyl chloride

Molecular and structural information

Molecular formula:
C7H4ClF3O2S
Molecular weight:
244.62
SMILES notation:
O=S(Cl)(=O)c1ccccc1C(F)(F)F
InChl:
InChI=1/C7H4ClF3O2S/c8-14(12,13)6-4-2-1-3-5(6)7(9,10)11/h1-4H
Structural formula:
Chemical structure

Related substances

Categories Display