Registration Dossier

Diss Factsheets

IUPAC name:
methyl 3-(2-bromopropanoylamino)-4-methyl-thiophene-2-carboxylate

Inventory

Synonyms

Molecular and structural information

Molecular formula:
C10H12BrNO3S
Molecular weight:
ca. 306.18
SMILES notation:
COC(=O)c1scc(C)c1NC(=O)C(C)Br
Structural formula:
Chemical structure

Related substances